The catabolic process of making yogurt is: anaerobic respiration acid fermentation alcohol fermentation aerobic respiration
The catabolic process of making yogurt is:
|
anaerobic respiration |
||
|
acid fermentation |
||
|
alcohol fermentation |
||
|
aerobic respiration |
Homework Answers
Lactic acid fermentation
Bacterias like streptococcus thermophilus ferments lactose to lactic acid. The lactic acid this produced lowers the pH and this causes for the milk to clot.
Add Answer to:
The catabolic process of making yogurt is:
anaerobic respiration
acid fermentation
alcohol fermentation
aerobic respiration
What is the difference between aerobic and anaerobic respiration? How does anaerobic respiration relate to fermentation?...
What is the difference between aerobic and anaerobic respiration? How does anaerobic respiration relate to fermentation? And what is the role of bacteria in bread making?
Which of the following yields the greatest energy for a cell: fermentation, anaerobic respiration, or aerobic...
Which of the following yields the greatest energy for a cell: fermentation, anaerobic respiration, or aerobic respiration? Which yields the least? Why?
lactic acid, alcohol, acetic acid and butanol are all examples of a- by product of aerobic...
lactic acid, alcohol, acetic acid and butanol are all examples of a- by product of aerobic respiration b- by product of anaerobic respiration c-products of substrate level phosphorylation d- fermentation waste products
Explain aerobic respiration versus anaerobic respiration in terms of the amount of ATP produced. In what...
Explain aerobic respiration versus anaerobic respiration in terms of the amount of ATP produced. In what scenario is anaerobic respiration performed? Explain why fermentation is required during anaerobic respiration? Where does aerobic respiration take place in the cell?
Microbiology question! 6. Microbes may have the ability to use aerobic cellular respiration, alcohol fermentation, and/or...
Microbiology question!
6. Microbes may have the ability to use aerobic cellular respiration, alcohol fermentation, and/or anaerobic respiration. Provide an example of a microbe that might be able to do this Explain how this occurs and describe when one pathway may be used over another. Which is most efficient? (5 pts)
Categorize the following: Aerobic respiration, Anaerobic respiration, Fermentation, None of these .Assume in all cases that...
Categorize the following: Aerobic respiration, Anaerobic respiration, Fermentation, None of these .Assume in all cases that these processes follow breakdown of glucose by glycolysis. Results in complete oxidation of glucose to CO2 Involves regeneration of reduced co-factors (e.g. regenerating NAD+ from NADH) Generates energy by substrate level phosphorylation only Generates ATP by oxidative phosphorylation Utilizes an electron transport chain Uses molecules such as NO3 - , SO4 2- , or Fe3+ as terminal electron acceptors Products include organic acids, alcohols,...
Cellular Respiration and Fermentation FIGURE 2 Stages of cellular respiration and fermentation. Celibalar respiration consists of...
Cellular Respiration and Fermentation FIGURE 2 Stages of cellular respiration and fermentation. Celibalar respiration consists of ghycolysis, the citric acid cycle, and the electron transport chain. Ghycolysis is also a sage in fermenstation Glucese Cysosol Pyruvate Mtochondrion Ethanoi Co Before you begin today's lab topic, refer to the preceding paragraph and Figure 2 fermentation and cellular respiration by answering the following questions. as you review major pathways, reactants, and products of 1. Which processes are anaerobic? 2. Which processes are...
#1: Microorganism Metabolism Concepts: match the concepts with the description. Anabolism Anaerobic respiration Anaerobic fermentation a....
#1: Microorganism Metabolism Concepts: match the concepts with the description. Anabolism Anaerobic respiration Anaerobic fermentation a. Breakdown of carbohydrates leading to oxidized carbon molecule and energy production b. The process of forming the primary cell energy compound in the electron transport chain when molecular oxygen is available C. Breakdown of carbohydrates leading to formation of required monomer compounds for cell growth d. The production of low MW alcohols or carboxylic acids when the absence of any electron acceptors precludes operation...
Exercise 7: Aerobic Respiration and Alcohol Fermentation 57 JUUUUUUUUUUUUU the magnesium ions, and they are no...
Exercise 7: Aerobic Respiration and Alcohol Fermentation 57 JUUUUUUUUUUUUU the magnesium ions, and they are no longer available to act as cofactors. Without its cofactor, an enzyme changes its three-dimensional form, and, as a result, has the shape of its active site altered. This enzyme's normal substrate will not be able to fit into this altered active site, and thus, the enzymatic reaction has been noncompetitively inhibited. If glycolysis is inhibited by NaF, fewer pyruvic acid molecules will be produced;...
QUESTION 43 Starting with a single glucose molecule, explain how aerobic respiration generates ATP. You do...
QUESTION 43 Starting with a single glucose molecule, explain how aerobic respiration generates ATP. You do NOT need to describe each chemical reaction along the way, but you must indicate the catabolic pathways that are used by aerobic respiration and at which points ATP is produced and how much ATP is produced. How does this differ from anaerobic respiration and fermentation? TTTT Paragraph v Arial 3 (120) X2 %DOQ Of Me Τ' Τ,
Microbiology question!
6. Microbes may have the ability to use aerobic cellular respiration, alcohol fermentation, and/or anaerobic respiration. Provide an example of a microbe that might be able to do this Explain how this occurs and describe when one pathway may be used over another. Which is most efficient? (5 pts)
Cellular Respiration and Fermentation FIGURE 2 Stages of cellular respiration and fermentation. Celibalar respiration consists of ghycolysis, the citric acid cycle, and the electron transport chain. Ghycolysis is also a sage in fermenstation Glucese Cysosol Pyruvate Mtochondrion Ethanoi Co Before you begin today's lab topic, refer to the preceding paragraph and Figure 2 fermentation and cellular respiration by answering the following questions. as you review major pathways, reactants, and products of 1. Which processes are anaerobic? 2. Which processes are...
#1: Microorganism Metabolism Concepts: match the concepts with the description. Anabolism Anaerobic respiration Anaerobic fermentation a. Breakdown of carbohydrates leading to oxidized carbon molecule and energy production b. The process of forming the primary cell energy compound in the electron transport chain when molecular oxygen is available C. Breakdown of carbohydrates leading to formation of required monomer compounds for cell growth d. The production of low MW alcohols or carboxylic acids when the absence of any electron acceptors precludes operation...
Exercise 7: Aerobic Respiration and Alcohol Fermentation 57 JUUUUUUUUUUUUU the magnesium ions, and they are no longer available to act as cofactors. Without its cofactor, an enzyme changes its three-dimensional form, and, as a result, has the shape of its active site altered. This enzyme's normal substrate will not be able to fit into this altered active site, and thus, the enzymatic reaction has been noncompetitively inhibited. If glycolysis is inhibited by NaF, fewer pyruvic acid molecules will be produced;...
QUESTION 43 Starting with a single glucose molecule, explain how aerobic respiration generates ATP. You do NOT need to describe each chemical reaction along the way, but you must indicate the catabolic pathways that are used by aerobic respiration and at which points ATP is produced and how much ATP is produced. How does this differ from anaerobic respiration and fermentation? TTTT Paragraph v Arial 3 (120) X2 %DOQ Of Me Τ' Τ,
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 45 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago