c) Compare and contrast DNA replication in prokaryotes and eukaryotes. Your answer should include a description...
c) Compare and contrast DNA replication in prokaryotes and eukaryotes. Your answer should include a description of replication as it would occur in these two types of cells.(20)
Homework Answers
DNA replication in prokaryotes
1. It occurs inside cytoplas
2. There is only one origin of replication .
3. origin of replication is made of 100 - 200 or more nucleotides .
4. Initiation is carried out by DnaA AND DnaB .
5. DNA gyrase is needed.
6. okazaki fragment are large 1000-2000 nucleotide .
7. replication is very rapid some 2000 base pairs are added.
Replication in eukaryotes.
1. it occurs in nucleus.
2. origin of replication are many over 1000 in each eukaryotic chromosome..
3. replication occurs at several points simultaneously in each chromosome.
4. initiation is carried out by multisubunit protein .
5. DNA gyrase is needed.
6. okazaki fragment are 100-200 nucleotide.
Add Answer to:
c) Compare and contrast DNA replication in prokaryotes and
eukaryotes. Your answer should include a description...
Compare and contrast DNA replication in prokaryotes and eukaryotes. Include three commonalities and three distinctions. Describe...
Compare and contrast DNA replication in prokaryotes and eukaryotes. Include three commonalities and three distinctions. Describe the molecular structure of DNA in all organisms. Contrast the differences in DNA structure between prokaryotes and eukaryotes. Compare and contrast DNA and RNA with respect to structure and function. Include three commonalities and three distinctions.
1. Compare and contrast Prokaryotes and Eukaryotes. 2. How can prokaryotic cells be smaller than eukaryotic...
1. Compare and contrast Prokaryotes and Eukaryotes. 2. How can prokaryotic cells be smaller than eukaryotic cells and still carry on all the essential functions of life. 3. Compare and contrast Archea and Bacteria.
26. Topoisomerases are enzymes that support DNA replication in prokaryotes and eukaryotes. These enzymes have been...
26. Topoisomerases are enzymes that support DNA replication in prokaryotes and eukaryotes. These enzymes have been used as targets for drug development. Answer the following questions on topoisomerases: (a) What are topoisomerases, what do they do, and how do they support DNA replication? (4 marks) (b) What is the difference between topoisomerase I and II? (2 marks) (c) Why is topoisomerase II an attractive drug target for bacterial pathogens? (2 marks)
Describe the process of DNA replication. (Your answer should include the following: replication fork, semiconservative replication,...
Describe the process of DNA replication. (Your answer should include the following: replication fork, semiconservative replication, replication fork, DNA gyrase, helicase, primase, DNA polymerase, DNA ligase, leading strand, lagging strand, continuous replication, non-continuous replication, and Okazaki fragment)
1. If DNA polymerase III was going to attach a new nucleotide onto the DNA molecule shown to the right, where would it attach it? 2. Why are the ends labeled A and C different? a. The diagram is...
1. If DNA polymerase III was going to attach a new nucleotide onto the DNA molecule shown to the right, where would it attach it? 2. Why are the ends labeled A and C different? a. The diagram is drawn incorrectly, they should be the same One is o pure onsa pyrimidine. c. One is a purine, one is a pyrimidine d. Double-stranded DNA is antiparallel. e. This is after DNA replication -before DNA replication, they look the same. 3....
A) Explain lagging strand DNA replication in detail. Underline the following terms in your answer: replication...
A) Explain lagging strand DNA replication in detail. Underline the following terms in your answer: replication fork, DNA polymerase III, primase, and ligation. Make sure that your answer is complete and that all the entities that come together in the process of lagging strand replication are clearly explained. Draw one figure of a replication fork with the polarity (directionality) of each DNA strand indicated. G) Explain RNA transcription in E. coli in detail, from initiation to termination. Underline the following...
1) Describe the basic similarities and differences between DNA replication and transcription 2) Compare and contrast...
1) Describe the basic similarities and differences between DNA replication and transcription 2) Compare and contrast the ways in which animal and bacterial viruses gain entry into their host cells.
Compare and contrast the climates and communities of two terrestrial biomes. Include the following in your...
Compare and contrast the climates and communities of two terrestrial biomes. Include the following in your comparison: a basic description of how their locations on the planet affect their temperature and rainfall an explanation of how their climate causes different amounts and types of life to flourish two specific examples of community interactions that occur in each community.
Compare and contrast Prokaryotic and Eukaryotic DNA replication For exam you must be able to describe...
Compare and contrast Prokaryotic and Eukaryotic DNA replication For exam you must be able to describe at least 3 specific similarities between the two and 3 specific differences between the two. An example of 1 difference is that prokaryotic replication has 1 replication bubble (one oriC). Eukaryotic replication has many replication bubbles (multiple origins of replication)
n your assigned readings, you learned DNA is used as a template to synthesize new DNA. This process is referred to as replication. Discuss the similarities and differences in DNA replication between...
n your assigned readings, you learned DNA is used as a template to synthesize new DNA. This process is referred to as replication. Discuss the similarities and differences in DNA replication between eukaryotes and prokaryotes. Are the changes in eukaryotes adaptations? Explain. Be sure to use in text citation and provide references for your sources. While not required for this discussion, you may use outside resources. Any materials cited in this course should be referenced using the APA style guidelines...
1. If DNA polymerase III was going to attach a new nucleotide onto the DNA molecule shown to the right, where would it attach it? 2. Why are the ends labeled A and C different? a. The diagram is drawn incorrectly, they should be the same One is o pure onsa pyrimidine. c. One is a purine, one is a pyrimidine d. Double-stranded DNA is antiparallel. e. This is after DNA replication -before DNA replication, they look the same. 3....
1) Describe the basic similarities and differences between DNA replication and transcription 2) Compare and contrast the ways in which animal and bacterial viruses gain entry into their host cells.
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 13 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 44 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago