What are two major types of protein secondary structure, and what kind of interaction holds them...
What are two major types of protein secondary structure, and what kind of interaction holds them together , and between what part of the protein do they occur?
Homework Answers
Two major type of secondary protein structure is present in alpha-helices and beta sheets.
Hydrogen bonding between the atoms in the peptide bonds along the chain holds the backbone together.
In an alpha helix, one sheet of C terminal amino acid sheet is parallel to the one N-terminal amino acid chain, shown in the above figure.
A beta helix is a protein structure formed by the association of parallel beta strands where both backbones of the protein chain are not parallel.
Add Answer to:
What are two major types of protein secondary structure, and
what kind of interaction holds them...
13. For secondary structure, the two major possible arrangements of the peptide chain and are 14. The structure def...
13. For secondary structure, the two major possible arrangements of the peptide chain and are 14. The structure defines the 3-dimensional shape of the compact structure of the peptide of a protein. 15. Not all proteins have a. primary structure b. secondary structu re c. tertiary structure d. quatemary structure 16. Bonds between sulfur groups on the amino acid(s) the protein structure and would be classified as can stabilize structure. 17. True/False Enzymes catalyze processes, meaning that they improve the...
The type of bonding that maintains the secondary structure in a protein is the
The type of bonding that maintains the secondary structure in a protein is theA) Hydrogen bonds between the carbonyl and amino groups of the backboneB) Covalent bond between the carbonyl and amino groups of the amino acidsC) Hydrogen bonds between two amino acidsD) Disulfide bonds that hold two polypeptide chains togetherE) Hydrogen bonds between two amino groups
24. How does insulin end up with 2 separate chains when it is produced as one sequence o amino acids. (4 points) 25.What is the difference between the hydrogen bonding which holds the secondary p...
24. How does insulin end up with 2 separate chains when it is produced as one sequence o amino acids. (4 points) 25.What is the difference between the hydrogen bonding which holds the secondary protein structures of and alpha helix and a beta pleated sheet together and the hydrogen bonding that holds the tertiary structure together? (4 points) 26. List the 6 classes of enzymes and describe what types of reactions they catalyze. (3 points per class of enzymes, 18...
1 through 5 please 1. Which level of protein structure is held together by hydrogen bonds...
1 through 5 please
1. Which level of protein structure is held together by hydrogen bonds only a) primary b) secondary c) tertiary d) quaternary 2. Which level of protein structure is held together by peptide bonds only a) primary b) secondary c) tertiary d) quaternary 3. Which level of protein structure is held together by R-group interactions? a) primary b) secondary c) tertiary d) quaternary " Which level of protein structure is likely to change when a substrate binds...
Predict what would happen to the secondary structure of a protein if an alcohol that disrupts...
Predict what would happen to the secondary structure of a protein if an alcohol that disrupts hydrogen bonding were added. Choose one or more answer (if applied): A. Nothing would happen to the protein; hydrogen bonding is not important for secondary structure B. The beta sheets would unfold, disrupting protein structure C. The a helixes would unfold, disrupting protein structure D. Individual amino acids would be hydrolyzed from the protein, disrupting protein structure
I got these multiple questions wrong, can anyone please help me why I got them wrong...
I got these multiple questions wrong, can anyone please help me why I got them wrong =( My answers are in bold, and were marked wrong 1. How do the two reagents used to separate peptide chains that are covalently linked via disulfide bonds function? Mercaptoethanol (oxidizes/reduces) the sulfurs and iodoacetate forms a (covalent/hydrophobic/ionic) interaction with them. 2. Differences at the PrP and the PrPSc proteins occur mainly at which protein structure level(s)? A Primary only B Secondary only C...
please answer! 3) Protein structure and amino acid side chains a) Give examples of the types...
please answer!
3) Protein structure and amino acid side chains a) Give examples of the types if attractive forces found between the side chains of the following amino acid residue pairs at pH 7.4 00 Leu and Phe (ii) Two Cys (ii) Asp and Thr (iv) Asp and Arg b) Of the 4 levels of protein structure, which ones are stabilized by interactions between amino acid side chains? c) Identify the two regular types of secondary structures and describe the...
What type of interaction would you expect between the following R groups in the tertiary structure of a protein?
What type of interaction would you expect between the following R groups in the tertiary structure of a protein?
What kind of research could you conduct or what types of primary and secondary research could...
What kind of research could you conduct or what types of primary and secondary research could be conducted in developing your marketing plan?
8. How do proteins interact with ligands? (What holds them together?) 9. What are the FOUR...
8. How do proteins interact with ligands? (What holds them together?) 9. What are the FOUR ways that protein function is regulated (function turned ON/OFF). Explain each. 1.
13. For secondary structure, the two major possible arrangements of the peptide chain and are 14. The structure defines the 3-dimensional shape of the compact structure of the peptide of a protein. 15. Not all proteins have a. primary structure b. secondary structu re c. tertiary structure d. quatemary structure 16. Bonds between sulfur groups on the amino acid(s) the protein structure and would be classified as can stabilize structure. 17. True/False Enzymes catalyze processes, meaning that they improve the...
24. How does insulin end up with 2 separate chains when it is produced as one sequence o amino acids. (4 points) 25.What is the difference between the hydrogen bonding which holds the secondary protein structures of and alpha helix and a beta pleated sheet together and the hydrogen bonding that holds the tertiary structure together? (4 points) 26. List the 6 classes of enzymes and describe what types of reactions they catalyze. (3 points per class of enzymes, 18...
1 through 5 please
1. Which level of protein structure is held together by hydrogen bonds only a) primary b) secondary c) tertiary d) quaternary 2. Which level of protein structure is held together by peptide bonds only a) primary b) secondary c) tertiary d) quaternary 3. Which level of protein structure is held together by R-group interactions? a) primary b) secondary c) tertiary d) quaternary " Which level of protein structure is likely to change when a substrate binds...
please answer!
3) Protein structure and amino acid side chains a) Give examples of the types if attractive forces found between the side chains of the following amino acid residue pairs at pH 7.4 00 Leu and Phe (ii) Two Cys (ii) Asp and Thr (iv) Asp and Arg b) Of the 4 levels of protein structure, which ones are stabilized by interactions between amino acid side chains? c) Identify the two regular types of secondary structures and describe the...
8. How do proteins interact with ligands? (What holds them together?) 9. What are the FOUR ways that protein function is regulated (function turned ON/OFF). Explain each. 1.
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago