Homework Answers
The given structure is of carbon (atomic number 6). Carbon has 4 electrons in its valance shell (outer most) and requires 4 electrons to complete the octate (most stable state). Hence carbon can form 4 covalent bonds (form by sharing of electrons) with other atom.
Example- CH4 (Methane)
Your answer (4) is correct
Add Answer to:
Question 7 The atom shown can form a maximum of how many bonds with other atoms?...
How many covalent bonds can a single chlorine atom form with other elements?
How many covalent bonds can a single chlorine atom form with other elements?
The valence electron configurations of several atoms are shown. How many bonds can each atom make...
The valence electron configurations of several atoms are shown. How many bonds can each atom make without hybridization? 1. B: 2s22p1 2.N: 2s22p3 3. O: 2s22p4
The valence electron configurations of several atoms are shown. How many bonds can each atom make...
The valence electron configurations of several atoms are shown. How many bonds can each atom make without hybridization? Part A Mg: 3s2 part B Cl: 3s23p5 Part C Al: 3s23p1
How many covalent bonds can a single fluorine atom commonly form with other elements? A. 3...
How many covalent bonds can a single fluorine atom commonly form with other elements? A. 3 B. 1 C. 4 D. 2
When are multiple bonds formed between atoms and why? Multiple bonds between atoms form in order that each atom can ach...
When are multiple bonds formed between atoms and why? Multiple bonds between atoms form in order that each atom can achieve an inner-shell electron octet. Multiple bonds between atoms form norder that each atom has more than 4 electrons and in the result this bond will be stronger than single. Multiple bonds form only between large atoms and it leads to the decreasing of electron density at these atoms. Multiple bonds between atoms form in order that each atom can...
When there are too many electrons or too few electrons and the atoms cannot or will not form multiple bonds, which atom...
When there are too many electrons or too few electrons and the atoms cannot or will not form multiple bonds, which atom in the structure does not recieve a complete or has an extended octet? Explain why only one atom in the structure is affected in these situations.
How many covalent bonds are predicted for each atom? ONE covalent bond TWO covalent bonds Atoms:...
How many covalent bonds are predicted for each atom? ONE covalent bond TWO covalent bonds Atoms: B THREE covalent bonds FOUR covalent bonds Se N
When an atom is bonded to other atoms, it can combine its valence shell orbital to...
When an atom is bonded to other atoms, it can combine its valence shell orbital to form a new set of orbitals that is at a lower total energy in the presence of the other atoms than the pure atomic orbitals would be. This process is called hybridization, and the new orbitals that are formed are called hybrid orbitals. These hybrid orbitals can overlap with orbitals on other atoms to share electrons and form bonds. Such hybrid orbitals usually give...
Question 7 1 pts How many equivalent resonance structures can be drawn for NO2F (N is the central atom) where all atoms...
Question 7 1 pts How many equivalent resonance structures can be drawn for NO2F (N is the central atom) where all atoms satisfy the octet rule? 03 0 1 o 4 O 2 Question 8 1 pts A resonance structure of ozone (03) is given blow. What is the formal charge on the central oxygen atom? ö-0–o: O +2 o-2 00 +1 Question 9 1 pts Which of the following is the best Lewis structure for CIF +? : 51:...
Atoms can bond to other atoms to make molecules. Atoms sometimes break these bonds and form...
Atoms can bond to other atoms to make molecules. Atoms sometimes break these bonds and form them in a different way. For example, it is possible to take two molecules of hydrogen (H_2) and one molecule of oxygen (O_2), put them near one another, give them a little spark to help them start a reaction, and you will end up with two molecules of water (H_2O). Do you see what happened? Some of the H-H bonds and the O-O bonds...
When are multiple bonds formed between atoms and why? Multiple bonds between atoms form in order that each atom can achieve an inner-shell electron octet. Multiple bonds between atoms form norder that each atom has more than 4 electrons and in the result this bond will be stronger than single. Multiple bonds form only between large atoms and it leads to the decreasing of electron density at these atoms. Multiple bonds between atoms form in order that each atom can...
How many covalent bonds are predicted for each atom? ONE covalent bond TWO covalent bonds Atoms: B THREE covalent bonds FOUR covalent bonds Se N
Question 7 1 pts How many equivalent resonance structures can be drawn for NO2F (N is the central atom) where all atoms satisfy the octet rule? 03 0 1 o 4 O 2 Question 8 1 pts A resonance structure of ozone (03) is given blow. What is the formal charge on the central oxygen atom? ö-0–o: O +2 o-2 00 +1 Question 9 1 pts Which of the following is the best Lewis structure for CIF +? : 51:...
Atoms can bond to other atoms to make molecules. Atoms sometimes break these bonds and form them in a different way. For example, it is possible to take two molecules of hydrogen (H_2) and one molecule of oxygen (O_2), put them near one another, give them a little spark to help them start a reaction, and you will end up with two molecules of water (H_2O). Do you see what happened? Some of the H-H bonds and the O-O bonds...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 49 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago