What is the major difference between the mechanisms of homology-directed repair, copy choice, and gene conversion...
What is the major difference between the mechanisms of homology-directed repair, copy choice, and gene conversion in DNA repair?
Homework Answers
Homology directed repair (HDR) mechanism: The homologous recombination is the most common form of homology directed repair, which is used in the repair of double stranded lesions of DNA. The cell can use HDR mechanism only if it contains the homologous region of DNA, probably either in the G2 or S phase.
Copy-choice repair or copy-choice recombination mechanism: The new DNA molecule is formed by the replication of each selected parental DNA (or RNA) molecules (with alternative maternal and paternal copies).
Gene conversion is a mismatch repair mechanism in which one allele is replaced by another homologous allele (transfer is unidirectional from the donor to recipient), the allele may be of the same gene.
Add Answer to:
What is the major difference between the mechanisms of
homology-directed repair, copy choice, and gene conversion...
Understand how non homologous end joining proteins and homology-directed repair work
Understand how non homologous end joining proteins and homology-directed repair work, how they are used in DNA repair, and how they are used in CRISPR/Cas9. Also understand the basics of how CRISPR/Cas9 can be used to alter DNA sequences.
What cell cycle phase should the cells be in to be perfect of Homology Directed Repair...
What cell cycle phase should the cells be in to be perfect of Homology Directed Repair in the moss Physcomitrella patens? And in which article is it stated?
During the Homology Directed Repair (HDR), what would happen if we were to provide the yeast...
During the Homology Directed Repair (HDR), what would happen if we were to provide the yeast cell with a 80bp repair template that contains a mutation in the PAM site?
Molecular biology of the gene. From the paper “DNA repair mechanisms and the bypass of DNA...
Molecular biology of the gene. From the paper “DNA repair
mechanisms and the bypass of DNA damage in saccaromyces cerevisiae”
3. In general for methyltransferase a. b. What type of damage does it repair? How does it repair the damage? lanhy the damaged guanine woulr hymine nstead of eyriosine
What is the Difference between homology and Analogy? What is Natural Selection? And What are some...
What is the Difference between homology and Analogy? What is Natural Selection? And What are some examples of it?
What are two major factors that contribute to DNA double-strand break repair pathway choice(HDR, NHEJ, or...
What are two major factors that contribute to DNA double-strand break repair pathway choice(HDR, NHEJ, or Alt.NHEJ)? Please explain
Part 1. Eukaryotes use at least two distinct mechanisms to control gene expression by altering the...
Part 1. Eukaryotes use at least two distinct mechanisms to control gene expression by altering the structure of chromatin around a particular gene. One of these mechanisms is the covalent modification of histones to switch DNA between an open and closed confirmation. A second mechanism is the covalent modification of DNA (typically on cytosines) by methylation. A. Describe a type of histone modification and explain what effect is has on chromatin, and how that effect is achieved. a. One type...
5) What mechanisms do cells use to repair the double-strand breaks (DSBs) induced by CRISPR/Cas9? Which...
5) What mechanisms do cells use to repair the double-strand breaks (DSBs) induced by CRISPR/Cas9? Which of these two methods allow cells to replace a defective gene (i.e. gene therapy)?
In Genetics, what is the difference between Epistasis and gene suppression?
In Genetics, what is the difference between Epistasis and gene suppression?
What are the 4 forms of gene transfer in bacteria? What is the difference between horizontal...
What are the 4 forms of gene transfer in bacteria? What is the difference between horizontal and vertical gene transfer? What is gene transfer? How genes move between genomes of bacteria.by the processes of transformation, transduction, conjugation, and transposition? How can gene transfer (conjugation, transformation) contribute to bacteria becoming resistant to antibiotic drugs?
Molecular biology of the gene. From the paper “DNA repair
mechanisms and the bypass of DNA damage in saccaromyces cerevisiae”
3. In general for methyltransferase a. b. What type of damage does it repair? How does it repair the damage? lanhy the damaged guanine woulr hymine nstead of eyriosine
Part 1. Eukaryotes use at least two distinct mechanisms to control gene expression by altering the structure of chromatin around a particular gene. One of these mechanisms is the covalent modification of histones to switch DNA between an open and closed confirmation. A second mechanism is the covalent modification of DNA (typically on cytosines) by methylation. A. Describe a type of histone modification and explain what effect is has on chromatin, and how that effect is achieved. a. One type...
What are the 4 forms of gene transfer in bacteria? What is the difference between horizontal and vertical gene transfer? What is gene transfer? How genes move between genomes of bacteria.by the processes of transformation, transduction, conjugation, and transposition? How can gene transfer (conjugation, transformation) contribute to bacteria becoming resistant to antibiotic drugs?
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 1 second ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 57 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago