What do the terms of similarity, identity and homology refer to?
What do the terms of similarity, identity and homology refer to?
Homework Answers
1. What do the terms of similarity, identity and homology refer to?
Similarity in the sequence alignment refers to the degree of likeness between two sequences. Identity refers to the number of characters that match exactly between two different sequences. Similarity can be calculated and usually expressed as a percentage of identical residues over a given length of the alignment. Homology refers to the common evolutionary ancestry of two sequences. It can only be assessed as either 'true' or 'false' and cannot be estimated as percentage. It is not mandate that homologous sequences should be similar ones. Bu there is a high probability of homology between two very similar sequences.
What is percent identity and percent similarity
What is percent identity and percent similarity
If two polypeptides share a great deal of amino acid sequence identity and similarity, what else...
If two polypeptides share a great deal of amino acid sequence identity and similarity, what else is likely to be true?
no explaination is needed 24. Similarity resulting from common ancestry is known as a) homology b)...
no explaination is needed
24. Similarity resulting from common ancestry is known as a) homology b) convergent evolution. c) divergent evolution. d) heterogeny 25. Which of the following statements concerning the loss of hind limbs during whale evolution is NOT true? a) The loss is well documented by a series of transitional fossils. b) It explains why modern whales have vestigial pelvic girdles. c) This evolutionary process involved changes in the sequence or expression of Hox genes. d) The loss...
To what do the terms "liability and "stockholders equity refer? 15. What information is provided in...
To what do the terms "liability and "stockholders equity refer? 15. What information is provided in the statement of cash flows? 16. What are notes to the financial statements? Illustrate how the double-entry accounting system works. 18. Why are financial statements prepared at regular intervals? Who are the users of these statements? 19. What is the basic accounting equation? How does it work? 20. Explain what is meant by the term "financial transaction". Give an example of a financial transaction....
What is the capital structure of the Technology Retail industry? How do you explain the similarity...
What is the capital structure of the Technology Retail industry? How do you explain the similarity or the difference between Best Buy and the Technology Retail industry?
What is the Difference between homology and Analogy? What is Natural Selection? And What are some...
What is the Difference between homology and Analogy? What is Natural Selection? And What are some examples of it?
How is identity communicated generally, and how do you communicate your identity? What is the relationship...
How is identity communicated generally, and how do you communicate your identity? What is the relationship between cultural and religious or spiritual identity? How are they different/similar?
Establish the identity. sin 0. sec 0 = tan 0 Write the left side in terms...
Establish the identity. sin 0. sec 0 = tan 0 Write the left side in terms of sine and cosine. sin 0. Write the result from the previous step as a single fraction. (Do not simplify.) The fraction from the previous step then simplifies to tan O using what? O A. Quotient Identity O B. Cancellation Property OC. Pythagorean Identity D. Even-Odd Identity O E. Reciprocal Identity
Describe and explain one major structural similarity between the protistan molds and the zygomycota (bread molds)...
Describe and explain one major structural similarity between the protistan molds and the zygomycota (bread molds) in terms of reproduction / dispersal. What similarities exist in the ecological function of these different organisms that may have resulted in this similarity? What evidence exists that allows us to view this similarity as a case convergent evolution?
What cell cycle phase should the cells be in to be perfect of Homology Directed Repair...
What cell cycle phase should the cells be in to be perfect of Homology Directed Repair in the moss Physcomitrella patens? And in which article is it stated?
no explaination is needed
24. Similarity resulting from common ancestry is known as a) homology b) convergent evolution. c) divergent evolution. d) heterogeny 25. Which of the following statements concerning the loss of hind limbs during whale evolution is NOT true? a) The loss is well documented by a series of transitional fossils. b) It explains why modern whales have vestigial pelvic girdles. c) This evolutionary process involved changes in the sequence or expression of Hox genes. d) The loss...
To what do the terms "liability and "stockholders equity refer? 15. What information is provided in the statement of cash flows? 16. What are notes to the financial statements? Illustrate how the double-entry accounting system works. 18. Why are financial statements prepared at regular intervals? Who are the users of these statements? 19. What is the basic accounting equation? How does it work? 20. Explain what is meant by the term "financial transaction". Give an example of a financial transaction....
Establish the identity. sin 0. sec 0 = tan 0 Write the left side in terms of sine and cosine. sin 0. Write the result from the previous step as a single fraction. (Do not simplify.) The fraction from the previous step then simplifies to tan O using what? O A. Quotient Identity O B. Cancellation Property OC. Pythagorean Identity D. Even-Odd Identity O E. Reciprocal Identity
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 51 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago