O c) >0 kcal/mol Question 37 1 pts Assuming that cytosine is in the first position of an anticodo...
Question 6: 10 pts 5 pts (A) Draw the structure of: 1. Deoxyadenylic acid 2. Uridine (B) Draw the two different dipeptides from L-tyrosine and L-alanine, showing the following in each structure. 1. the stereochemistry of the chiral centers 2. the N terminal 3. the C terminal 4, the peptide bond H3C OH OH NH2 NH2 HO L-alanine L-tyrosine ΝΗ, N pyrimidine purine NH O NH H,C, NH "NH NH NH H H H cytosine ( uracil (U; occurs in...
please solve all, thnak you Question 47 4 pts In class, we discussed several unique properties of water that make it particularly suitable for supporting life. Choose any one of these properties, explain why water has this property, and describe why the property is important for life 12pt Paragraph B I VA 2 TV Question 48 1 pts Which base pairs with Guanine (G) in DNA? Thymine (T) Uracil (U) Adenine (A) O Cytosine (C) Question 49 2 pts A...
What are the three functional groups that comprise a nucleotide? What do nucleotides have in common with amino acids or simple sugars? When the structure of DNA was first elucidated, many biologists quickly saw how this structure explained the passage of information from one generation to another. How does the structure of DNA explain generation-to-generation flow of information? In other words, give a brief description of the structure of DNA and tell how this structure allows for replication. Which of...
Thank you!! Question 50 1 pts The first start codon you see in the same sequence) is the one the ribosome uses to start translation Which reading frame, therefore, is the correct one? 5'ACUAGCAGGAGACGUAAGCGAUGUGCCAGAUGCGCAGUCACACAUAACUGCAAG 3' third fourth sixth fifth second first
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...
1.Which of the following is not an oligosaccharide? Trehalose Nodulation factor Streptomycin Amylose Maltose 2.Which strand of DNA is replicated exclusively in a discontinuous fashion? forward strand reverse strand leading strand lagging strand the strand that is read in a 5’ to 3’ direction 3.Which of the following statements about DNA synthesis in eukaryotes is correct? Synthesis of linear chromosomes leads to telomere shortening in somatic cells Unwinding of DNA by helicases is facilitated by positive supercoils DNA synthesis is...
Question 33 2 pts Which of the following statements about the process of DNA replication is true? It involves the enzyme DNA ligase, which corrects point mutations. It utilizes DNA polymerase, which catalyzes the reaction that adds a new nucleotide to the growing strand. The sequence on the new strand is always identical to one of the old parent strands. Adenine pairs with guanine, and cytosine pairs with thymine. Question 34 2 pts The DNA base...
Question 1 (1.5 pts] The total strain energy of conformation A is 10.5 kcal/mole (R denotes the same unspecified alkyl group). What strain energy (in kcal/mole) is associated with a single R:R 1,3-diaxial interaction? Please enter just the numerical value rounded to one decimal place. Please do not include units H HT HUT HHHH HH Conformation A Question 2 (1.5 pts] Rank conformations B, C and D from most stable to least stable (most stable first). IC H (CH2CH2CH3)3 CH(CH3)2...
25. What binds to a stop codon on a mRNA during translation? a. transcription factor c. termination factor b. tRNA d. transcription initiator 26. What is typically attached to the acceptor end of a tRNA? a. a protein b. an amino acid C a ribosome d. a nucleosome 27. During mRNA processing, what is put on the 3' end of a primary mRNA transcript? a. a poly-A tail b. a cap d. an intron c. an exon 28. Which of...
25 20 15 Free Energy (kcal/mol) M B 10 r 5 0 Reaction progress Use the reaction energy diagram above to answer the following questions, Calculate the activation energy. AG #, for the step C to B. Include algebraic sign. Calculate the overall energy change, AG®, for the process to D. Include algebraic sign. Which step is faster, (a) to A or (b) A to B? O a Ob kcal/mol kcal/mol Submit Submit and Next : Mark this question for...