Design a circuit that adds together 4X and 2X to give 6X, where X is X2X1X0,...
Design a circuit that adds together 4X and 2X to give 6X, where X is X2X1X0, and gives a 6-bit sum S5S4S3S2S1S0. This can be done using 2 half adders and 1 full adder, no additional gates are required.
Homework Answers
Add Answer to:
Design a circuit that adds together 4X and 2X to give 6X, where
X is X2X1X0,...
[Paperl (10 pts.) Design a circuit that takes in four 4-bit unsigned numbers, A (A3..Ao), B (B3.....
[Paperl (10 pts.) Design a circuit that takes in four 4-bit unsigned numbers, A (A3..Ao), B (B3..Bo), C (C3-C), and D (D3..Do) and produces the 6-bit unsigned sum of those numbers. You should use three 4-bit adder blocks (74LS283's), and a minimal number of full adders or half adder build blocks. You should organize your adder circuits to perform as many additions in parallel (at the same time) as possible. Getting started: Write out the columns of addition and see...
1. Using only half adders, design a four-bit incrementer circuit (a circuit that adds 1 to...
1. Using only half adders, design a four-bit incrementer circuit (a circuit that adds 1 to a four- bit binary number). 2. Using only 2-to-4 line decoders with enable, construct a 4-to-16 line decoder. 3. Using a decoder and external gates, design the combinational circuit defined by the following three Boolean functions: F = x'y'z' + x2 F2 = xy'z' + x'y F3 = x'y'z + xy
3. PRELAB 1. A half adder is a circuit that has two inputs, A and B,...
3. PRELAB 1. A half adder is a circuit that has two inputs, A and B, and two outputs, sum and carry. It adds A and B according to the rules of binary addition and outputs the sum and carry. Design a half-adder circuit using one XOR gate and one AND gate. Verify your design through truth table and with Multisim. 2. Whereas the half adder added two inputs A and B, the full adder adds three inputs together, A,...
Problem 2. Ripple Carry and Carry Look-ahead Adders For the binary adding circuit that adds n-bit...
Problem 2. Ripple Carry and Carry Look-ahead Adders For the binary adding circuit that adds n-bit inputs x and y, the following equation gives ci+1 (the carry out bit from the i" position) in terms of the inputs for the ih bit sum x, yi, and ci (the carry-in bit): Letting gi xiyi and pi = xi+yi, this can be expressed as: ci+1 = gi+piCi a) In a ripple carry adder structure, the carry bits are computed sequentially. That is,...
number 4 and 5 please! PROBLEM STATEMENT A logic circuit is needed to add multi-bit binary...
number 4 and 5 please!
PROBLEM STATEMENT A logic circuit is needed to add multi-bit binary numbers. A 2-level circuit that would add two four-bit numbers would have 9 inputs and five outputs. Although a 2-level SOP or POS circuit theoretically would be very fast, it has numerous drawbacks that make it impractical. The design would be very complex in terms of the number of logic gates. The number of inputs for each gate would challenge target technologies. Testing would...
You are to design a circuit that calculates the Hamming distance between two 5-bit numbers. It...
You are to design a circuit that calculates the Hamming distance between two 5-bit numbers. It takes two 5-bit binary numbers A4 A3 A2 A1 A0 and B4 B3B 2B1 B0 as inputs and returns the number of bits that are different between the two numbers as the 3-bit binary output O2 O1 O0. For example: *If the two input numbers were 10111 and 00001 then the output would be 011 as there are 3 bits different between them. *If...
Design a Combinational circuit that forms that form the 2-bit binary Sum S1S2 of two 2-bit...
Design a Combinational circuit that forms that form the 2-bit binary Sum S1S2 of two 2-bit numbers X1X0 and Y1Y0 and can produce a carry ouput C. Design the entire circuit with the help of three half adder circuits implementing each of the three outputs with XOR-AND and OR gates
Design a combinational circuit that adds 1 to 3-bit unsigned binary number and produces an unsigned...
Design a combinational circuit that adds 1 to 3-bit unsigned binary number and produces an unsigned binary result. Do the following: (1) determine the number of inputs/outputs, (2) write the truth table, (3) simplify the output functions by using maps and (4) draw the logic diagram by using AND OR and NOT gates. Show the truth table, the map, and the logic diagram. Do NOT use adders.
For number 2 you can use exclusive-OR gates, but do not use multiplexers. 1. Design a...
For number 2 you can use
exclusive-OR gates, but do not use multiplexers.
1. Design a 4-bit adder/subtractor using only full adders and EXCLUSIVE- OR gates. Do not use any multiplexers. 2. Design a combinational circuit using a minimum number of Full adders, and logic gates which will perform A plus B or minus B (A and B are signed numbers), depending on a mode select input, M. If M=0, addition is carried out; if M1, subtraction is carried out....
Problem 3 [10 points a) (5 points) Construct a circuit that takes as input a 3-bit number X-XXXo ...
part c
Problem 3 [10 points a) (5 points) Construct a circuit that takes as input a 3-bit number X-XXXo and increments it by one. L.e. if the input is 101 the output should be 110. Use only half adders. b) Construct a circuit that takes as input a 3-bit number X-XXxo and decrements it by one 1. (5 points) Show the truth table of the circuit. Then use a decoder and additional gates to implement it. So Ys Y2...
[Paperl (10 pts.) Design a circuit that takes in four 4-bit unsigned numbers, A (A3..Ao), B (B3..Bo), C (C3-C), and D (D3..Do) and produces the 6-bit unsigned sum of those numbers. You should use three 4-bit adder blocks (74LS283's), and a minimal number of full adders or half adder build blocks. You should organize your adder circuits to perform as many additions in parallel (at the same time) as possible. Getting started: Write out the columns of addition and see...
1. Using only half adders, design a four-bit incrementer circuit (a circuit that adds 1 to a four- bit binary number). 2. Using only 2-to-4 line decoders with enable, construct a 4-to-16 line decoder. 3. Using a decoder and external gates, design the combinational circuit defined by the following three Boolean functions: F = x'y'z' + x2 F2 = xy'z' + x'y F3 = x'y'z + xy
3. PRELAB 1. A half adder is a circuit that has two inputs, A and B, and two outputs, sum and carry. It adds A and B according to the rules of binary addition and outputs the sum and carry. Design a half-adder circuit using one XOR gate and one AND gate. Verify your design through truth table and with Multisim. 2. Whereas the half adder added two inputs A and B, the full adder adds three inputs together, A,...
Problem 2. Ripple Carry and Carry Look-ahead Adders For the binary adding circuit that adds n-bit inputs x and y, the following equation gives ci+1 (the carry out bit from the i" position) in terms of the inputs for the ih bit sum x, yi, and ci (the carry-in bit): Letting gi xiyi and pi = xi+yi, this can be expressed as: ci+1 = gi+piCi a) In a ripple carry adder structure, the carry bits are computed sequentially. That is,...
number 4 and 5 please!
PROBLEM STATEMENT A logic circuit is needed to add multi-bit binary numbers. A 2-level circuit that would add two four-bit numbers would have 9 inputs and five outputs. Although a 2-level SOP or POS circuit theoretically would be very fast, it has numerous drawbacks that make it impractical. The design would be very complex in terms of the number of logic gates. The number of inputs for each gate would challenge target technologies. Testing would...
Design a combinational circuit that adds 1 to 3-bit unsigned binary number and produces an unsigned binary result. Do the following: (1) determine the number of inputs/outputs, (2) write the truth table, (3) simplify the output functions by using maps and (4) draw the logic diagram by using AND OR and NOT gates. Show the truth table, the map, and the logic diagram. Do NOT use adders.
For number 2 you can use
exclusive-OR gates, but do not use multiplexers.
1. Design a 4-bit adder/subtractor using only full adders and EXCLUSIVE- OR gates. Do not use any multiplexers. 2. Design a combinational circuit using a minimum number of Full adders, and logic gates which will perform A plus B or minus B (A and B are signed numbers), depending on a mode select input, M. If M=0, addition is carried out; if M1, subtraction is carried out....
part c
Problem 3 [10 points a) (5 points) Construct a circuit that takes as input a 3-bit number X-XXXo and increments it by one. L.e. if the input is 101 the output should be 110. Use only half adders. b) Construct a circuit that takes as input a 3-bit number X-XXxo and decrements it by one 1. (5 points) Show the truth table of the circuit. Then use a decoder and additional gates to implement it. So Ys Y2...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 1 minute from now -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago