Homework Answers
PALLIATIVE CARE
Palliative care is the active holistic care of individuals across all ages with serious health suffering due to severe illnesses especially those who are near to end of life. There is some wrong information about palliative care, The aim of palliative care is to support the clients to maintain independence and improve the quality of life with severe illness, but some people believe that in palliative care patient depends on care gives for care. Also, there is a myth that the palliative care is only provided in hospitals, actually it can be provided in the home also, It is applicable to all health care settings, primary, secondary, territory settings..It can be provided by professionals with basic training in palliative care, not by all nurses. It is not a pain relief care for dying people .It is applicable throughout the course of an illness based on the clients' needs.
1. Define palliative care 2. Define hospice care 3. What is the difference between palliative care...
1. Define palliative care 2. Define hospice care 3. What is the difference between palliative care and hospice 4. Give an example of a patient that can benefit from palliative care. And in what ways would palliative care be helpful? 5. Give an example of a patient that can benefit from hospice care. And in what ways would hospice care be helpful?
What is the family's role in palliative care?
What is the family's role in palliative care?
What is a nurse’s role in providing palliative care
What is a nurse’s role in providing palliative care
What is the difference between hospice and palliative care? What is your view on hospice and/or...
What is the difference between hospice and palliative care? What is your view on hospice and/or palliative care? What is your view on euthanasia? Do you have an advanced directive, living will or power of attorney? add citation
one key message of the text is that the principles of hospice palliative care can be...
one key message of the text is that the principles of hospice palliative care can be interpreted into care early in the dying process. is this a new concept for you?write about this idea. what are the benefits of the palliative approach?do you already follow some of these principles?
1. What is the difference between hospice and palliative care? 2. What is your view on...
1. What is the difference between hospice and palliative care? 2. What is your view on hospice and/or palliative care?3 . What is your view on euthanasia? 4.Do you have an advanced directive, living will or power of attorney?
1. What is the difference between hospice and palliative care? 2. What is your view on...
1. What is the difference between hospice and palliative care? 2. What is your view on hospice and/or palliative care?3 . What is your view on euthanasia? 4.Do you have an advanced directive, living will or power of attorney?
Select a palliative care program to review. In your assessment consider the purpose, need, value, service,...
Select a palliative care program to review. In your assessment consider the purpose, need, value, service, organizational structure, regulation, administration, and contrast to hospice care. After the initial assessment (as seen above) , provide future directions for this type of care (For example: What is the future of palliative care? How might palliative care evolve in the healthcare industry?) The discussion should be professional, include detailed information, and be void of opinion.
What members of the interprofessional health care team provide palliative/hospice care, and what roles do they...
What members of the interprofessional health care team provide palliative/hospice care, and what roles do they play?
Compare and contrast hospice care and palliative care.
Compare and contrast hospice care and palliative care.
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 42 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago