Use the following lead-acid battery cell to answer the related questions:
PbO2 (s) │PbSO4 (s) │H2SO4 (aq) (1 M) ‖ H2SO4 (aq) (1 M)│Pb (s) │PbSO4 (s)
A. (5 pts) Determine the Cell potential for the battery at 25°C
B. (5 pts) A high output alternator for a KIA soul can produce 220 Amp current. How long would it take to recharge/reform 4.03 kg of Pb at that rate (assuming your battery is near dead)?
A. Cell potential
ER Pb2+/Pb = - 0.13 V
EL Pb4+/Pb2+ = +1.67 V
Ecell = ER -EL
= -0.13 -(+1.67)
Ecell = - 1.8 V
E = E0 - 0.0592/2 log(1)
E = E0 - 0.0
Ecell = E0cell
B. Time required to recharge
Mass of deposition = Z * I * t
where, mass = 4030 g ;
I = 220 Amp;
Z=
i.e., 'n' is the number of electrons transfered; here n = 2
4030 = * 220 * t
t =
t = 777790000/13970
t = 55675.7 sec
Use the following lead-acid battery cell to answer the related questions: PbO2 (s) │PbSO4 (s) │H2SO4...
What mass of lead sulfate (PbSO4) is formed in a lead-acid storage battery when 1.00 g of Pb undergoes oxidation? Hint: Lead-Acid batter cell: Pb(s) + PbO2(s) + 2 H2SO4(aq) – 2 PbSO4(s) + 2 H2 O(1) Hint #2: Convert grams to moles and then moles back into grams.
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
Question 10 0.5 pts What mass of lead sulfate (PbSO4) is formed in a lead-acid storage battery when 1.00 g of Pb undergoes oxidation? Hint: Lead-Acid batter cell: Pb(s) + PbO2(s) + 2 H2SO4(aq) → 2 PbSO4(s) + 2 H2O(1) Hint #2: Convert grams to moles and then moles back into grams. Mass of PbSO4 formed = 0.007 grams Mass of PbSO4 formed = 0.275 grams Mass of PbSO4 formed = 1.225 grams Mass of PbSO4 formed = 2.275 grams...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
In a lead acid battery (the battery that is used to start your car), the following reaction occurs: Pb(s) + PbO2(s) + 2 H2SO4(aq) → 2 PbSO4(s) + 2 H2O(l) How many electrons are transferred in this reaction? Enter your answer as an integer.
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
The spontaneous galvanic cell of a lead storage battery (a typical car battery) is composed of the following reduction half reactions reduced 1.69 v Pb02 (s)+ HSO, (aq)+3 Ha0 (aq) + 2 e Pbs04 (s)+5 H20) PbSO4 (s) + H3O (aq) 2 e Pb (s)+HSO (aq)+ H20 (I) E reduced 0.36 V How much current (in A) does a cell phone charger for your car use if your car dies after 14 hours of leaving the phone plugged in without...
18. Identify the oxidant and reductant of the following reaction in a lead-acid battery. Pb(s) + PbO2(s) + 2H2SO4(aq) → 2PbSO4(s) + 2H2O(l)
The cell diagram for the lead-acid cell that is used in automobile and truck batteries is Pb(s)|PbSO4(s)H, SO, (aq)|P60, (8), PbSO4) Pb(s) The comma between PbO,(s) and PbSO (3) denotes a heterogeneous mixture of the two solids. The right-hand lead electrode is nonreactive. Write the balanced equation for the net cell reaction. equation: Look up standard potentials for the oxidation and reduction half-reactions, and then calculate the value of Econ call = Calculate the value of AG an AG in...
9.) (8 pts.) Use the following /2 cell information to answer the question below: Cu(s) | Cul(s) | Kl(aq) (0.075 M)||| The potential (E) for this 12 cell may be calculated using the Nernst equation and the following 12 reaction and standard potential: Cul(s) + e 5 Cu(s) + I'(aq) E° = -0.185 V Show that an equivalent potential (E) can be calculated for this 12 cell using the following 12 reaction and the Ksp value for Culs). You must...