Write the complement for the DNA sequence below (including directionality). 5’-ATCGGCGTA-3’
Write the complement for the DNA sequence below (including directionality).
5’-ATCGGCGTA-3’
Homework Answers
Ans. According to chargaff rule, Adenine (A) always pairs with thymine (T) while cytosine(C) always pairs with guanine (G) .
The two strands in DNA are anti parallel. This means if one strand have polarity from 5' to 3' then other strand will have polarity from 3' to 5'.
So complementary sequence will be -
3' - TAGCCGCAT - 5'.
Add Answer to:
Write the complement for the DNA sequence below
(including directionality).
5’-ATCGGCGTA-3’
Q4) A) Write the complement (also known as inverse complement) of the sequence below indicating its...
Q4) A) Write the complement (also known as inverse complement) of the sequence below indicating its directionality-5’-ACGGGCATTAGACATCCACGGAAATTCGCAG B)Mark the recognition site(s) in this sequence for the restriction enzyme FokI which recognizes the sequence GGATG
3. The partial gene (DNA) sequence below contains multiple PAM sequences. Highlight six PAM sequences in...
3. The partial gene (DNA) sequence below contains multiple PAM sequences. Highlight six PAM sequences in the top (5' to 3) strand. 5'-GCACGGCGGAGCGGTTCTTGGCAGCGGCCGCACGATCTCGTTGCCGCCGG- 3' 3-CGTGCCGCCTCGCCAAGAACCGTCGCCGGCGTGCTAGAGCAACGGCGGCC- 5' Once Cas9 binds to a PAM sequence, it unwinds the DNA. If the guide RNA matches the DNA sequence next to the PAM, the guide RNA will bind to the complementary DNA strand. If not, the DNA will zip back together and Cas9 will keep binding to other PAM sequences until it finds the...
You are given the following sequence of DNA which encodes for a short protein (this is...
You are given the following sequence of DNA which encodes for a short protein (this is the template strand). 3'ATAGAAGTACCTCGGGCATTTTGAGTTAGCCACTGATACAT 5' 1) Write the sequence of the coding strand. Make sure to label your ends to indicate directionality. 2) Write the sequence of the mRNA. Assume that the entire molecule will be transcribed. Make sure to label your ends to indicate directionality. 3) Write the primary structure sequence of the protein which this would make. Make sure to label your...
Question 15 2 pts Given the DNA sequence 3 GTACG5' what is the sequence of the...
Question 15 2 pts Given the DNA sequence 3 GTACG5' what is the sequence of the complementary strand? Include the directionality! (the 3' and 5 on the ends so I know which direction the strand is going)
ASSIGNMENT For the DNA sequence given below, write the complementary DNA sequence that would complete the...
ASSIGNMENT For the DNA sequence given below, write the complementary DNA sequence that would complete the double-strand. DNA 3’—A T T G C T T A C T T G C A T -- 5’ DNA 5’-- Does it matter which strand is the ‘code strand’? The following two sequences look identical, except one runs 3’-5’ and the other 5’-3’. For each DNA sequence given below, write the mRNA sequence that would be coded from it. Make sure you indicate the direction of each mRNA strand (i.e. 3’ and 5’ ends). Use the Universal triplet code to...
Given the template DNA sequence below: 3'-CCACCTTCTATACTTCGCGGAATGCCGGTCCATGTAGGTTCACATTAGCGT-5' 6. An error occurred in DNA replication, A was...
Given the template DNA sequence below: 3'-CCACCTTCTATACTTCGCGGAATGCCGGTCCATGTAGGTTCACATTAGCGT-5' 6. An error occurred in DNA replication, A was incorporated in the place of T (indicated in yellow color in the aforementioned sequence) from the gene. Write the corresponding DNA template strand and transcribe the mutated mRNA strand, then determine the amino acid sequence of the mutant protein. If a stop codon is not present, create one by adding sequences to the gene and mRNA.
The following DNA sequence encodes the beginning of the protein 5’ ATGCTAGCCCTAGCTGATAACATTCTACGTATAATAAATTTCCTA 3’ #1 Write the...
The following DNA sequence encodes the beginning of the protein 5’ ATGCTAGCCCTAGCTGATAACATTCTACGTATAATAAATTTCCTA 3’ #1 Write the mRNA sequence of this stretch of DNA. (how it would read if this gene would be transcribed) #2 Write the protein sequence in single letter code that corresponds to the mRNA sequence.
Below is the coding DNA sequence for a gene called tribble, including the wild-type and several...
Below is the coding DNA sequence for a gene called tribble, including the wild-type and several mutant alleles. For each mutant allele, fully classify the mutation and its effect in the amino acid sequence. Wild-type 5'-ATGGCAACTACATATAGCACAGTTTGAACC-3' a. Mutant allele #1 5'-ATGGCAACTACATAAAGCACAGTTTGAACC-3' b. Mutant allele #2 5'-ATGGCAACTACATATAGCATAGTTTGAACC-3' c. Mutant allele #3 5'-ATGGCAACTACATACAGCACAGTTTGAACC-3' d. Which mutant allele is most likely to be a knockout and why?
If the sequence of the 5'-3'DNA strand is AATGCTAC, then the complementary DNA sequence has the...
If the sequence of the 5'-3'DNA strand is AATGCTAC, then the complementary DNA sequence has the following sequence o 3-AATGCTAC-5' 3'-CATCGTAA-5 3-GTAGCATT-5 3-TTACGATG-5 Question 2 20 pts Which of the following does the enzyme primase make? phosphodiester linkages (bonds) Okazaki fragments RNA primer DNA primer In which direction does DNA replication take place? 3'to 5 5'to 5 5'to 3 3'to 3 Question 4 20 pts Which enzyme unwinds the double-stranded helical DNA starting at the origin of replication? ligase primase...
5. Nucleic acids A region of DNA has a sequence 5'- TTAGCCTC-3' A. Write the complementary...
5. Nucleic acids A region of DNA has a sequence 5'- TTAGCCTC-3' A. Write the complementary sequence for this strand. B. How many purines are in the new strand? C. Why is the monomer of nucleic acids different from a monomer of carbohydrates?
3. The partial gene (DNA) sequence below contains multiple PAM sequences. Highlight six PAM sequences in the top (5' to 3) strand. 5'-GCACGGCGGAGCGGTTCTTGGCAGCGGCCGCACGATCTCGTTGCCGCCGG- 3' 3-CGTGCCGCCTCGCCAAGAACCGTCGCCGGCGTGCTAGAGCAACGGCGGCC- 5' Once Cas9 binds to a PAM sequence, it unwinds the DNA. If the guide RNA matches the DNA sequence next to the PAM, the guide RNA will bind to the complementary DNA strand. If not, the DNA will zip back together and Cas9 will keep binding to other PAM sequences until it finds the...
You are given the following sequence of DNA which encodes for a short protein (this is the template strand). 3'ATAGAAGTACCTCGGGCATTTTGAGTTAGCCACTGATACAT 5' 1) Write the sequence of the coding strand. Make sure to label your ends to indicate directionality. 2) Write the sequence of the mRNA. Assume that the entire molecule will be transcribed. Make sure to label your ends to indicate directionality. 3) Write the primary structure sequence of the protein which this would make. Make sure to label your...
Question 15 2 pts Given the DNA sequence 3 GTACG5' what is the sequence of the complementary strand? Include the directionality! (the 3' and 5 on the ends so I know which direction the strand is going)
Given the template DNA sequence below: 3'-CCACCTTCTATACTTCGCGGAATGCCGGTCCATGTAGGTTCACATTAGCGT-5' 6. An error occurred in DNA replication, A was incorporated in the place of T (indicated in yellow color in the aforementioned sequence) from the gene. Write the corresponding DNA template strand and transcribe the mutated mRNA strand, then determine the amino acid sequence of the mutant protein. If a stop codon is not present, create one by adding sequences to the gene and mRNA.
Below is the coding DNA sequence for a gene called tribble, including the wild-type and several mutant alleles. For each mutant allele, fully classify the mutation and its effect in the amino acid sequence. Wild-type 5'-ATGGCAACTACATATAGCACAGTTTGAACC-3' a. Mutant allele #1 5'-ATGGCAACTACATAAAGCACAGTTTGAACC-3' b. Mutant allele #2 5'-ATGGCAACTACATATAGCATAGTTTGAACC-3' c. Mutant allele #3 5'-ATGGCAACTACATACAGCACAGTTTGAACC-3' d. Which mutant allele is most likely to be a knockout and why?
If the sequence of the 5'-3'DNA strand is AATGCTAC, then the complementary DNA sequence has the following sequence o 3-AATGCTAC-5' 3'-CATCGTAA-5 3-GTAGCATT-5 3-TTACGATG-5 Question 2 20 pts Which of the following does the enzyme primase make? phosphodiester linkages (bonds) Okazaki fragments RNA primer DNA primer In which direction does DNA replication take place? 3'to 5 5'to 5 5'to 3 3'to 3 Question 4 20 pts Which enzyme unwinds the double-stranded helical DNA starting at the origin of replication? ligase primase...
5. Nucleic acids A region of DNA has a sequence 5'- TTAGCCTC-3' A. Write the complementary sequence for this strand. B. How many purines are in the new strand? C. Why is the monomer of nucleic acids different from a monomer of carbohydrates?
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago