Homework Answers
Ans-13- The shape of double-stranded DNA is double helix in which two strands of DNA run in the opposite direction.
Ans-14- DNA is called the blueprint of life because it contains all the information required for the growth, development, survival, and reproduction of an organism. DNA do so by expressing the proteins which are structural and functional components of a cell.
Add Answer to:
13. What is the shape of DNA? 14. Why is DNA called the "Blueprint of Life"?
1. Write out the full name for DNA. 2. Why is the nucleus called the "control...
1. Write out the full name for DNA. 2. Why is the nucleus called the "control center" of the cell? 3. Where in the cell are the chromosomes located? 4. What is a gene? 5. What do proteins do for your body? 6. What holds the sides of the DNA ladder together? 7. What are the sides of the DNA ladder made of? 8. What three parts make up a single nucleotide? 9. What are the 4 bases that make...
DN A is often called the "blueprint of life." However, DNA is composed of only four...
DN A is often called the "blueprint of life." However, DNA is composed of only four nitrogen bases s par o its nucleotide structure. Explain how these four nitrogen bases can influence the genetic makeup of an individual. Hydrolysis: is an example of catabolism requires water to be added to a molecu results in a net release of energy breaks the covalent bonds between mon all of the above
SELLUN 9. Contrast the functions of DNA polymerase III and DNA polymerase I. 10. Why do...
SELLUN 9. Contrast the functions of DNA polymerase III and DNA polymerase I. 10. Why do are the start points of DNA replication in eukaryotic and prokaryotic organisms AT rich? 11. What is the start point of DNA replication called in E. coli? What is it called in humans? 12. In DNA replication in E. coli which enters the replication fork first, DnaA protein, or Helicase? 13. In eukaryotes, two proteins are involved in linking DNA replication to S phase...
14 15 A spherical bacterial cell shape is called a. What is term for the shapes...
14 15 A spherical bacterial cell shape is called a. What is term for the shapes of these cells? b. There are two kinds of arrangements that are characteristic for these types of cells. Name one. 16 17 Members of what prokaryotic Kingdom are often referred to as extremophiles due to their Yeasts undergo a type of asexual reproduction habits of extreme environments like high salt or acidity? called: a. binary fission c. conjugation b. budding d. tranformation 18 19...
Blueprint Reading question. What is one key factor why a designer may choose on cam transition...
Blueprint Reading question. What is one key factor why a designer may choose on cam transition motion over another? A. Speed B. Time C. Dwell D. Stress
A cell's genome is its blueprint for life. However, what is the bare minimum number of...
A cell's genome is its blueprint for life. However, what is the bare minimum number of genes needed to sustain a free-living cell? This is a question that microbiologists at the J. Craig Venter Institute (JCVI) have attempted to answer ever since they sequenced the genomes of several Mycoplasma species in the 1990s. Because Mycoplasma species are parasitic bacteria, their genomes are already reduced in size and hence provide an excellent foundation for creating a "minimal cell." However, little did...
Why only four nucleic acids are used for DNA in virtually all life forms out of...
Why only four nucleic acids are used for DNA in virtually all life forms out of the thousands of nucleic acids known to chemists is evidence of the common ancient origin of all life forms.
14. A type of DNA repair, in which a DNA glycosylase enzyme cleaves the bond between...
14. A type of DNA repair, in which a DNA glycosylase enzyme cleaves the bond between nucleotide's sugar and its attached base, is called ____.
Central Dogma and the Spider Silk Goats Introducing DNA Sequences called Promoters So why is the...
Central Dogma and the Spider Silk Goats Introducing DNA Sequences called Promoters So why is the spider sillk protein ONLY made in A PROMOTER is a non-coding DNA the mammary tissues ofsequence that controls the goat?!?!?! when and where a gene is turned on" (transcribed)! We know enough about promoters that we can engineer where a particular gene is expressed (switched on) and its protein is made. Promoter Transcription unit 3' DNA Start point RNA polymerase We were unable to...
Bio 100 LECTURE ACTIVITY 9 No Way, DNA Complete the following crossword puzzle: in A ....
Bio 100 LECTURE ACTIVITY 9 No Way, DNA Complete the following crossword puzzle: in A . Nepregen. Nucleotide, Adienne. Phase Pro Derio, rose Nucle Acil Double Hola, Cowell, d uk Thymi racit Wandrick Dowa: ACROSS 3 - Guanine pairs with this mucloeide 4- T-Pairs with this nucleotide 6- This replaces Thymine on RNA backbone buse attaches to the 5 carbon sugar 12. Each unit of DNA is called a 13 - This is the 5-carbon sugar 14. A. Pairs with...
1. Write out the full name for DNA. 2. Why is the nucleus called the "control center" of the cell? 3. Where in the cell are the chromosomes located? 4. What is a gene? 5. What do proteins do for your body? 6. What holds the sides of the DNA ladder together? 7. What are the sides of the DNA ladder made of? 8. What three parts make up a single nucleotide? 9. What are the 4 bases that make...
DN A is often called the "blueprint of life." However, DNA is composed of only four nitrogen bases s par o its nucleotide structure. Explain how these four nitrogen bases can influence the genetic makeup of an individual. Hydrolysis: is an example of catabolism requires water to be added to a molecu results in a net release of energy breaks the covalent bonds between mon all of the above
SELLUN 9. Contrast the functions of DNA polymerase III and DNA polymerase I. 10. Why do are the start points of DNA replication in eukaryotic and prokaryotic organisms AT rich? 11. What is the start point of DNA replication called in E. coli? What is it called in humans? 12. In DNA replication in E. coli which enters the replication fork first, DnaA protein, or Helicase? 13. In eukaryotes, two proteins are involved in linking DNA replication to S phase...
14 15 A spherical bacterial cell shape is called a. What is term for the shapes of these cells? b. There are two kinds of arrangements that are characteristic for these types of cells. Name one. 16 17 Members of what prokaryotic Kingdom are often referred to as extremophiles due to their Yeasts undergo a type of asexual reproduction habits of extreme environments like high salt or acidity? called: a. binary fission c. conjugation b. budding d. tranformation 18 19...
Central Dogma and the Spider Silk Goats Introducing DNA Sequences called Promoters So why is the spider sillk protein ONLY made in A PROMOTER is a non-coding DNA the mammary tissues ofsequence that controls the goat?!?!?! when and where a gene is turned on" (transcribed)! We know enough about promoters that we can engineer where a particular gene is expressed (switched on) and its protein is made. Promoter Transcription unit 3' DNA Start point RNA polymerase We were unable to...
Bio 100 LECTURE ACTIVITY 9 No Way, DNA Complete the following crossword puzzle: in A . Nepregen. Nucleotide, Adienne. Phase Pro Derio, rose Nucle Acil Double Hola, Cowell, d uk Thymi racit Wandrick Dowa: ACROSS 3 - Guanine pairs with this mucloeide 4- T-Pairs with this nucleotide 6- This replaces Thymine on RNA backbone buse attaches to the 5 carbon sugar 12. Each unit of DNA is called a 13 - This is the 5-carbon sugar 14. A. Pairs with...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago