Homework Answers
a)
Diphtheria toxin is produced by Corynebacterium
diphtheriae. The toxin is a single polypetide composed of 535
amino acids. The polypeptide contains 2 subunits A and B. The
subunit B is for binding to the cell surface and subunit A
penetrates into the cell. Both the subunits A and b are linked by
disulfide bridges. The subunit A is the lethal factor. This subunit
contains cataytic domain or C domain having amino terminal. The C
domain exhibits unusual 
folding. The C domain blocks protein synthesis in host by transfer
of ADP-ribose from NAD to a diphthamide residue of eukaryotic
elongation factor 2 (eEF-2). As a result, elongation factor EF-2
becomes inactivated and protein synthesis is arrested in the host
resulting in death. This mechanism is similar to exotoxin produced
by Pseudomonas aeruginosa.
Add Answer to:
What component of the diphtheria toxin is comparable to lethal factor? What eukaryotic protein does the...
Where does the Corynebacterium diphtheria toxin come from and how is its expression regulated? Should the...
Where does the Corynebacterium diphtheria toxin come from and how is its expression regulated? Should the expression be on or off in a host and why?
Because pre-mRNA splicing is an essential process in eukaryotic cells, pre-mRNA splicing mutants are often lethal. a. De...
Because pre-mRNA splicing is an essential process in eukaryotic cells, pre-mRNA splicing mutants are often lethal. a. Design a genetic screen to identify genes required for splicing. b. You identify a gene using the screen and discover that the gene encodes a protein containing a DEAD box. What does this suggest about the role of the protein in the splicing process?
cholera toxin inhibits (prevents) what? a GPCR from binding to its G protein G alpha from...
cholera toxin inhibits (prevents) what?
a GPCR from binding to its G protein G alpha from exchanging GDP for GTP G alpha and beta gamma separation the deactivation of a Gs protein.
Question 20 TFIID is a. a protein and a transcription factor. b. an enzyme. c. a...
Question 20 TFIID is a. a protein and a transcription factor. b. an enzyme. c. a promoter and a transcription factor. d. a promoter. e. part of the TATA box. Question 19 Without maintenance methyltransferase, the changes made by DNA methyltransferase would not a. be able to increase transcription of a gene. b. be passed on from one generation to the next c. coordinate regulation across different genes. d. produce microRNA. e. be able to decrease transcription of a gene....
Which of the following is NOT expected when a eukaryotic cell is deprived from Oxygen? Question...
Which of the following is NOT expected when a eukaryotic cell is deprived from Oxygen? Question 40 Not yet answered Points out of 2.50 P Flag question Select one: O a. The formation of CO2 from cell respiration stops o b. Reduction of the production of ATP by substrate level phosphorylation in the mitochondria c. All listed events are expected in a eukaryotic cell deprived of oxygen O d. The cell reduces pyruvate (fermentation) to allow the ETC to continue...
1. Describe the differences between prokaryotic and eukaryotic translation initiation. How does the ribosome find the...
1. Describe the differences between prokaryotic and eukaryotic translation initiation. How does the ribosome find the correct start codon and what proteins are involved in the process? please include the shine-dalgarno sequence in the answer. 2. Consider the following partial sequence of messenger RNA. The sequence below contains the code for a short, complete protein. 5 ́-UCCCCAGUCAUGGAGUCGUUAAUUAAAUGACCGGUGCGGAUCGUA - 3 ́ Using the codon chart (from your textbook or in the lecture slides), give the amino acid sequence of the protein...
What level of protein structure is correct for the general transcription factor TFIID? Consider the follow...
What level of protein structure is correct for the general transcription factor TFIID? Consider the follow segment of an mRNA, ggguuaugacgacccccaauaaaggaaacaag... What would be the amino acid sequence? From which human gene is the above mRNA transcribed?
where does transcription begin 3. List the major types of RNA and include what they code...
where does transcription begin
3. List the major types of RNA and include what they code for, their function in the cell and which type is translated. 4. If a bacterial protein has 2,500 amino acids long, how many nucleotide pairs long is the ger sequence that codes for it? 5. Where does transcription begin? 6. What is the template and nontemplate strands of DNA? 7. Why is only one strand transcribed, and is the same strand of DNA always...
1. The M protein found on the cell walls of Streptococcus pyogenes is a virulence factor...
1. The M protein found on the cell walls of Streptococcus pyogenes is a virulence factor because it thwarts what part of our immune system? it minimizes phagocytosis complement proteins are not effective against it antibodies that are produced are not effective it does not stimulate antibody production 2. If you run an acid-fast stain on a sputum sample from a patient and the result is positive it indicates that the individual has been infected with Pseudomonas Mycobacterium HIV...
Protein Folding - a) what is the molten globule? b) How does the activity of chaperones...
Protein Folding - a) what is the molten globule? b) How does the activity of chaperones in unfolding molten globules may enhance the overall rate of folding to the native state? c) Name a protein folding disease. d) Give two possible general causes for disease arising from protein folding defects.
cholera toxin inhibits (prevents) what?
a GPCR from binding to its G protein G alpha from exchanging GDP for GTP G alpha and beta gamma separation the deactivation of a Gs protein.
Question 20 TFIID is a. a protein and a transcription factor. b. an enzyme. c. a promoter and a transcription factor. d. a promoter. e. part of the TATA box. Question 19 Without maintenance methyltransferase, the changes made by DNA methyltransferase would not a. be able to increase transcription of a gene. b. be passed on from one generation to the next c. coordinate regulation across different genes. d. produce microRNA. e. be able to decrease transcription of a gene....
Which of the following is NOT expected when a eukaryotic cell is deprived from Oxygen? Question 40 Not yet answered Points out of 2.50 P Flag question Select one: O a. The formation of CO2 from cell respiration stops o b. Reduction of the production of ATP by substrate level phosphorylation in the mitochondria c. All listed events are expected in a eukaryotic cell deprived of oxygen O d. The cell reduces pyruvate (fermentation) to allow the ETC to continue...
where does transcription begin
3. List the major types of RNA and include what they code for, their function in the cell and which type is translated. 4. If a bacterial protein has 2,500 amino acids long, how many nucleotide pairs long is the ger sequence that codes for it? 5. Where does transcription begin? 6. What is the template and nontemplate strands of DNA? 7. Why is only one strand transcribed, and is the same strand of DNA always...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 25 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 56 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago