why is signal transduction not associated with ion-gated channels?
Homework Answers
Simply because signal transduction usually requires a receptor-ligand interaction and a cascade of proteins working one after another in a pipeline, like receptor tyrosine kinase signalling , G-protein coupled signalling, whereas ion-gated channels are involved with maintaining membrane potential and alteration of membrane potential is usually/mostly the end result of the signalling cascade.
Hope it helps .... Regards
3. What is the major difference between gated and non-gated ion channels? Describe and draw an...
3. What is the major difference between gated and non-gated ion channels? Describe and draw an example of each type of gating signal. (6 marks)
determine whether each term or phrase describes ligand-gated ion channels, voltage-gated ion channels, or both.
determine whether each term or phrase describes ligand-gated ion channels, voltage-gated ion channels, or both.
QUESTION 18 Gated ion channels include each of the following except O A. voltage-gated channels. OB....
QUESTION 18 Gated ion channels include each of the following except O A. voltage-gated channels. OB. mechanosensitive channels. O C. ligand-gated channels. OD. potassium leak channels. E. All of these are types of gated channels
Compare the roles that Na+-gated and K+-gated ion channels play in an action potential.
Compare the roles that Na+-gated and K+-gated ion channels play in an action potential.
Which of the following statement(s) regarding gated channels is/are FALSE? Gated channels facilitate the passage of...
Which of the following statement(s) regarding gated channels is/are FALSE? Gated channels facilitate the passage of ions such as Cl- and Na+ across the plasma membrane. Gated channels open or close in response to a signal. Gated channels facilitate the passage of small, nonpolar molecules such as O2 across the plasma membrane. Gated channels allow for the passive movement of substances across the plasma membrane in a process called facilitated diffusion. Gated channels facilitate the passage of small, nonpolar molecules...
The opening of metabotropic G-protein-coupled receptor ion channels is faster than ionotropic transmitter-gated ion channels, triggering...
The opening of metabotropic G-protein-coupled receptor ion channels is faster than ionotropic transmitter-gated ion channels, triggering a wide- spread cellular metabolic effect. True False
Although the ligand-gated ion are ion channels they are considered to be receptors as they only...
Although the ligand-gated ion are ion channels they are considered to be receptors as they only open when bound by which of the following? select two answers please- 1)protein 2)ligands 3)drugs 4)ions 5)sugars
Compare and contrast the actions of g couple proteins and ion gated channels.
Compare and contrast the actions of g couple proteins and ion gated channels.
What are similarities and differences of g couple proteins and ion gated channels?
What are similarities and differences of g couple proteins and ion gated channels?
choices for A: Na+/K+ pumps, voltage gated K+ channels, voltage gated Ca+ channels, voltage gated Na+...
choices for A: Na+/K+ pumps, voltage gated K+ channels,
voltage gated Ca+ channels, voltage gated Na+ channels
choices for B: bidirectionally, unidirectionally
choices for C: Na+/K+ pumps, voltage gated K+ channels,
voltage gated Ca+ channels, voltage gated Na+ channels
choices for D: Na+/K+ pumps, voltage gated K+ channels,
voltage gated Ca+ channels, voltage gated Na+ channels
Consider this graph illustrating the generation of an action potential across the plasma membrane of a stimulated neuron. +40 ACTION POTENTIAL plasma membrane potential...
3. What is the major difference between gated and non-gated ion channels? Describe and draw an example of each type of gating signal. (6 marks)
determine whether each term or phrase describes ligand-gated ion channels, voltage-gated ion channels, or both.
QUESTION 18 Gated ion channels include each of the following except O A. voltage-gated channels. OB. mechanosensitive channels. O C. ligand-gated channels. OD. potassium leak channels. E. All of these are types of gated channels
Which of the following statement(s) regarding gated channels is/are FALSE? Gated channels facilitate the passage of ions such as Cl- and Na+ across the plasma membrane. Gated channels open or close in response to a signal. Gated channels facilitate the passage of small, nonpolar molecules such as O2 across the plasma membrane. Gated channels allow for the passive movement of substances across the plasma membrane in a process called facilitated diffusion. Gated channels facilitate the passage of small, nonpolar molecules...
The opening of metabotropic G-protein-coupled receptor ion channels is faster than ionotropic transmitter-gated ion channels, triggering a wide- spread cellular metabolic effect. True False
choices for A: Na+/K+ pumps, voltage gated K+ channels,
voltage gated Ca+ channels, voltage gated Na+ channels
choices for B: bidirectionally, unidirectionally
choices for C: Na+/K+ pumps, voltage gated K+ channels,
voltage gated Ca+ channels, voltage gated Na+ channels
choices for D: Na+/K+ pumps, voltage gated K+ channels,
voltage gated Ca+ channels, voltage gated Na+ channels
Consider this graph illustrating the generation of an action potential across the plasma membrane of a stimulated neuron. +40 ACTION POTENTIAL plasma membrane potential...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago