Unsaturated fatty acids are often classified according to the number of carbon atoms between the terminal methyl carbon (the omega carbon) and the closest double bond to the methyl end of the chain. An omega-3 fatty acid, for example, would have a double bond in position 3 counting from the methyl end of the molecule. Identify which omega class each fatty acid belongs to.
palmitoleic acid- omega 7
oleic acid- omega 9
linoleic acid- omega 6
arachidonic acid- omega 6
alpha linolenic acid- omega 3
gamma linolenic acid- omega 6
eicosapentaenoic acid (EPA)- omega 3
essential classes of fatty acids are omega 3 and omega 6.
Unsaturated fatty acids are often classified according to the number of carbon atoms between the terminal methyl carbon
all fatty acids contain a _____ chain of carbon atoms with a ______group. Saturated fatty acids contain _____; unsaturated fatty acids contain _______. Chapter 15 roblem 15.5 Part A Describe some simlarises and dferences in the structures of a saturated taty acid and an unsaturated faty acid Drag the terms on the left to the appropriate blanks on the right to complete the sentences Reset Help long All faty acids contein a chain of carbon atoms with a group Saturated...
35. Omega-3 fatty acids have their first double bond at the _______ carbon, while omega-6 fatty acids have their first double bond at the _______ carbon.a. first; secondb. second; thirdc. third; sixthd. sixth; third36. Glycerol can be converted to carbohydrate througha. gluconeogenesisb. beta oxidationC. glycogenesisd. oxidative phosphorylation37. Why do plant-based fats (oils) tend to be liquid at room temperature, unlike animal fats, which are solid at room temperature?a. Because plant-based oils have higher unsaturated fatty acid contentb. Because plant-based oils...
this type of fatty acid is classified as Question 18 18. This type of fatty acid is classified as: a). polyunsaturated b). mono saturated c). mono unsaturated 19. This type of fat is classified as: a) poly saturated b) tri unsaturated c) poly unsaturated d) unsaturated e) saturated 20. Identify the class of lipid to which the following molecule belongs. 1. a) fatty acid 2.b) triglyceride 3. c) wax 4.d) glycerophospholipid H.C-o HC-0 H,C- 21. Hydrophilic head Aqueous solution "Hydrophobic...
QUESTION 7 Select the true statement. @ A. They have 50-100 carbon atoms. B. They have 12-20 carbon atoms and an even number of carbons. OC. They have 12-20 carbon atoms with conjugated double bonds. D. They have fewer than 12 carbon atoms and are usually made of an uneven number of carbon atoms. QUESTION 3 A fatty acid that is designated an omega-3 fatty acid A. has three double bonds. B. is saturated. C. has a double bond three...
Match the description or component with the category. Categories can be used more than once. Double bond has its Contains partially- hydrogenated unsaturated fatty acids Multiringed lipid that is a major component of cell membranes Each carbon atom in this hydrogen atoms on opposite sides of the molecule fatty acid's carbon chain has two hydrogens Alpha-linolenic acid Primary type of fatty acid in beef and butter Used to make bile and Linoleic acid EPA and DHA AA certain hormones fat...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
4. A list of fatty acids is given below. The number of carbons each contains, as well as the number of double bonds, are listed right after the name. Rank the fatty acids 1-5 from highest melting point to lowest melting point. 1 - highest melting point, 5 - lowest melting point. Palmitic acid (16 carbons, 0 double bonds) Oleic acid (18 carbons, 1 double bond) Linolenic acid (18 carbons, 3 double bonds) Lauric acid (12 carbons, 0 double bonds)...
LIPID AND MEMBRANE QUESTIONS 1. If an unsaturated fatty acid has 18 carbons, a double bond at position would be in notation - 2. The functional groups which hold fatty acid molecules and glycerol molecules together in triacylglecerol molecules are called: 3. If a triacylglycerol is heated in aqueous sodium hydroxide (lye) solution glycerol and the sodium salts of fatty acids are produced. This mixture of sodium salts of fatty acids is called in common terminology 4. Name the four...
3. Unpolluted rain has an approximate pH of 5.5. Natural emissions (from volcanoes and lightning), and human activity (from mining and industrial plants) emit compounds that mix with water vapor in the atmosphere to create "acid rain," which can have a pH-4.5. Referring to the pH equation, explain why decreasing pH numbers mean that the acidity is increasing. a. Referring to the pH equation, explain why more acidic solutions have lower pH values. b. Referring to the pH equation, explain...
(CHO)n- CH1403a-C7H1407 C7H107 cellulose and chitin- starch and glycogen-sucrose-galactose- maltose-fructose-fatty acids- polymer-monomer-saturated- unsaturated-glycerol- glycogen-collagen hemoglobin-ribose- nitrogen base- chitin-phosphate group-insulin-pentose sugar-carbon- nitrogen- hydrogen-phosphorus- steroids- hydrolysis- dehydration-hydrogen bond- covalent bond-peptide bond- disulfide bond-guanine-cytosine- adenine-thymine- uracil-van der Waals-hydrophobic- sugar and phosphate bond- 1.A is a large organic molecule that contains repeating subunits called 2. A has fatty acids with double bonds, is liquid at room temperature and comes from a plant source. 3. Amino acids are joined together by bonds. 4. All molecules...