- Describe the study we discussed in class where scientists were attempting to assess deletion alleles...
- Describe the study we discussed in class where scientists were attempting to assess deletion alleles in patients with muscular dystrophy? Describe what they did and what they found. What about MD allowed them to study it this way?
Homework Answers
Add Answer to:
- Describe the study we discussed in class where scientists were
attempting to assess deletion alleles...
1) 7 pts - Discuss how the technique of PCR allows a scientist to quickly clone...
1) 7 pts - Discuss how the technique of PCR allows a scientist to quickly clone a particular piece of DNA. Be clear about the importance of 2 primers and Taq DNA polymerase. Make sure you explain how you do a PCR – what is needed. 2) 6pts - Describe the study we discussed in class where scientists were attempting to assess deletion alleles in patients with muscular dystrophy? Describe what they did and what they found. What about MD...
What are two common forms of human errors? Describe where each one results from. Describe their differences. How do we prevent these errors from occurring using the concepts discussed in class
What are two common forms of human errors? Describe where each one results from. Describe their differences. How do we prevent these errors from occurring using the concepts discussed in class
In my class we did an experiement where we measured the flicker frequency of an incandescent...
In my class we did an experiement where we measured the flicker frequency of an incandescent bulb and a CFL bulb (powered by a 60hz wall plug) using a photodiode and a osciloscope. We were then asked some questions about the sinusoidal curves that were produced. 1. The incandescent bulb probably has a large "DC offset". Why do you think this is? (im struggling with this question) 2. Is the flicker frequency for each of them the same as the...
e.g. chronic kidney disease patients If you were carrying out case-control study, describe where you would...
e.g. chronic kidney disease patients If you were carrying out case-control study, describe where you would select an appropriate comparison group (i.e. those without chronic kidney disease) from? Be specific in describing the type of people you might include and where you recruited them from, justifying why these characteristics are important from a study design perspective (1-2 paragraphs)
1. Consider the pendulum model that we discussed in class. It's also on page 71 of the lecture notes 4. Again, for simplicity, we assume m-1-1-1 Suppose in addition we consider a damping force of...
1. Consider the pendulum model that we discussed in class. It's also on page 71 of the lecture notes 4. Again, for simplicity, we assume m-1-1-1 Suppose in addition we consider a damping force of this model as follows. The magnitude of the damping force is proptional to angular velocity while its direction is opposite to the one of the angular velocity. For simplicity, we may assume the damping force to be -' Then the net external torque become τ...
2. In class we discussed the Stackelberg market competition model in the case where there were...
2. In class we discussed the Stackelberg market competition model in the case where there were two firms sequentially announcing their production quantities qı and q2. Recal that we assumed the firms wish to maximize profit (which equals revenue minus cost) The cost to firm i to produce q, units is cq, and the per unit sales price when Q q2 units are produced in total is P(Q)-α-Q if Q-α and zero otherwise. We assume Suppose now there are three...
Who were the Anasazi, where did they live, and how do we know what we do...
Who were the Anasazi, where did they live, and how do we know what we do about them (what kind of evidance do we have left behind) ? According to fared Daimond , what is chaco's massage ?
SECTION 3A: CASE STUDY APPLICATION – WALMART “EARLY YEARS” (40 of 120 POINTS) We have discussed...
SECTION 3A: CASE STUDY APPLICATION – WALMART “EARLY YEARS” (40 of 120 POINTS) We have discussed the evolution of Walmart in class. Part 3A is about Walmart before Amazon became a significant competitive force. In other words, Walmart was competing against similar retailers such as Target in physical locations versus online e-commerce. Answer the following questions. 1. From the customer’s POV, use the right strategic framework (Value Star or Advantage Profile) to describe how Walmart attracted customers to grow to...
1. Know the three nursing theorist discussed in class. What were their theories about? If given...
1. Know the three nursing theorist discussed in class. What were their theories about? If given a case study could you choose which theory was being referenced? (Roy, Watson, Wald) 2. Know about the different nursing organizations and what they do (ANA, NLN, NSNA, AACN) 3. Systems theory... have a general understanding of the topic 4. What is the Nurse Practice Act? 5. Know the difference between certification, licensure, & registration 6. General knowledge about Cultural diversity and sensitivity and...
3. (30 pts. total) We discussed the iodination of acetone in class. An alternative, but equivalent,...
3. (30 pts. total) We discussed the iodination of acetone in class. An alternative, but equivalent, way of writing the reaction is: acid H3C-C-CH3 + 131 acetone triiodide H3C-C-CH2 + 21 + H* iodoacetone iodide Is provides a more useful way to introduce 12 into the system. Iz is also useful because it absorbs visible light, and the rate of the reaction can be monitored by measuring the decrease in its absorbance at 565 nm. (Any time you can measure...
1. Consider the pendulum model that we discussed in class. It's also on page 71 of the lecture notes 4. Again, for simplicity, we assume m-1-1-1 Suppose in addition we consider a damping force of this model as follows. The magnitude of the damping force is proptional to angular velocity while its direction is opposite to the one of the angular velocity. For simplicity, we may assume the damping force to be -' Then the net external torque become τ...
2. In class we discussed the Stackelberg market competition model in the case where there were two firms sequentially announcing their production quantities qı and q2. Recal that we assumed the firms wish to maximize profit (which equals revenue minus cost) The cost to firm i to produce q, units is cq, and the per unit sales price when Q q2 units are produced in total is P(Q)-α-Q if Q-α and zero otherwise. We assume Suppose now there are three...
Who were the Anasazi, where did they live, and how do we know what we do about them (what kind of evidance do we have left behind) ? According to fared Daimond , what is chaco's massage ?
1. Know the three nursing theorist discussed in class. What were their theories about? If given a case study could you choose which theory was being referenced? (Roy, Watson, Wald) 2. Know about the different nursing organizations and what they do (ANA, NLN, NSNA, AACN) 3. Systems theory... have a general understanding of the topic 4. What is the Nurse Practice Act? 5. Know the difference between certification, licensure, & registration 6. General knowledge about Cultural diversity and sensitivity and...
3. (30 pts. total) We discussed the iodination of acetone in class. An alternative, but equivalent, way of writing the reaction is: acid H3C-C-CH3 + 131 acetone triiodide H3C-C-CH2 + 21 + H* iodoacetone iodide Is provides a more useful way to introduce 12 into the system. Iz is also useful because it absorbs visible light, and the rate of the reaction can be monitored by measuring the decrease in its absorbance at 565 nm. (Any time you can measure...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 19 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago