What enzymes are added to a sample during RNA isolation to obtain pure RNA? A. DNase...
What enzymes are added to a sample during RNA isolation to obtain pure RNA?
|
A. DNase only |
||
|
B. Lysozyme only |
||
|
C. RNase only |
||
|
D. Lysozyme and RNase |
||
|
E. DNase, and Lysozyme |
||
|
F. RNase and DNase |
Homework Answers
Presence of DNA is the main contamination during RNA isolation. The DNA is degraded by using DNase enzyme. Since we are isolating RNA we can't use RNase. Lysozyme are used to degrade bacterial cell wall.
So option A (DNase only) is correct
Add Answer to:
What enzymes are added to a sample during RNA isolation to
obtain pure RNA?
A. DNase...
10.During the plasmid isolation procedure we used an enzyme called RNAase. Does RNAase bind RNA specifically...
10.During the plasmid isolation procedure we used an enzyme called RNAase. Does RNAase bind RNA specifically or non-specifically? Why do we use RNAase? If instead of adding RNAase to the sample, what would happen if we added DNase?
Need help with number 1,5,6,7 and 8 please Restriction enzymes are a.) bacterial enzymes that elongate...
Need help with number 1,5,6,7 and 8 please
Restriction enzymes are a.) bacterial enzymes that elongate DNA b.) viral enzymes that destroy host DNA c.) bacterial enzymes that destroy incoming foreign DNA d.) animal enzymes that splice RNA Mice that are injected with only the R strain of Streptococcus pneumoniae a.) become sick and then recover b.) stay healthy, this is a non-virulent strain c.) are killed, this is the virulent strain Mice that are injected with only the S...
What happens if the wrong nucleotide is added during RNA transcription?
What happens if the wrong nucleotide is added during RNA transcription?
You are given a sample of RNA diluted 1:5. You read the OD260 for be 0.45....
You are given a sample of RNA diluted 1:5. You read the OD260 for be 0.45. How much of the non-diluted RNA would be needed to obtain 5ug (micro-grams) of total RNA? A. 5 ml B. 111 ul C. 11.1 ul D. 55.5 ul E. 1.1 ul
strand(s) and the RNA molecule is made up of strand(s). The DNA molecule is made up...
strand(s) and the RNA molecule is made up of strand(s). The DNA molecule is made up of O a. 4; 2 Ob. 1; 1 O c. 2; 1 O d. 1; 2 O e. 2; 4 QUESTION 45 The formation of large molecules from small subunits is known as what kind of reaction? O a reduction O b.condensation Oc decarboxylation d. hydrolysis O e. oxidation What is formed when an atom loses or gains an electron? O a. ion b....
4. Telomerases... a) are RNA-containing enzymes involved in replicating the ends of linear chromosomes b) cause...
4. Telomerases... a) are RNA-containing enzymes involved in replicating the ends of linear chromosomes b) cause aging in cells c) are structures located at the ends of eukaryotic chromosomes d) are needed by bacteria to complete synthesis of their chromosome ends e) are needed by bacteria to supercoil DNA 5. DNA methylation a) Modifies bases of tRNA molecules, allowing wobble b) Alters the activity of DNA polymerase by affecting access to the DNA c) Is a modification of histone tails...
In order to replicate RNA viruses such as COVID19 must first be converted to DNA. What...
In order to replicate RNA viruses such as COVID19 must first be converted to DNA. What viral enzyme would be an attractive drug target to inhibit this step? A. COVID spike protein B. RNase C. DNA polymerase D. Reverse Transcriptase.
A 30.5 g sample of pure metal at 156.7˚C is added to a 0.700 kg of...
A 30.5 g sample of pure metal at 156.7˚C is added to a 0.700 kg of water (specific heat capacity = 4.180 J/˚C g) at 23.0 ˚C. What is the final temperature of the water if the metal is (a) antimony, specific heat capacity of 0.210 J/˚C g (b) iridium, specific heat capacity of 1.30 J/˚C g? Assume all heat is conserved.
QUESTION 5 Match these terms to the descriptions below. b. , is added onto mRNA during...
QUESTION 5 Match these terms to the descriptions below. b. , is added onto mRNA during processing d , proteins that help initiate RNA synthesis a. spliceosome b. cap c. telomere d. transcription factors e. promoter a, removes introns from primary RNA transcript TATA-rich DNA sequence indicating the start site of a gene c repeating sequences found at the ends of linear DNA
12. The saccharide binding pockets in lysozyme were labeled A through F. Enzymes such as lysozyme...
12. The saccharide binding pockets in lysozyme were labeled A through F. Enzymes such as lysozyme are very specific; lysozyme will hydrolyze the polysaccharide at only one linkage: the linkage bound between A and B, or bound between B and C, etc. (see figure below). From the crystal structure, it was found a) NAG-NAG-NAG binds at sites A-C in the crystal structure, and b) that sites A, C and E could not accommodate NAM; NAM's extra lactyl group is too...
10.During the plasmid isolation procedure we used an enzyme called RNAase. Does RNAase bind RNA specifically or non-specifically? Why do we use RNAase? If instead of adding RNAase to the sample, what would happen if we added DNase?
Need help with number 1,5,6,7 and 8 please
Restriction enzymes are a.) bacterial enzymes that elongate DNA b.) viral enzymes that destroy host DNA c.) bacterial enzymes that destroy incoming foreign DNA d.) animal enzymes that splice RNA Mice that are injected with only the R strain of Streptococcus pneumoniae a.) become sick and then recover b.) stay healthy, this is a non-virulent strain c.) are killed, this is the virulent strain Mice that are injected with only the S...
strand(s) and the RNA molecule is made up of strand(s). The DNA molecule is made up of O a. 4; 2 Ob. 1; 1 O c. 2; 1 O d. 1; 2 O e. 2; 4 QUESTION 45 The formation of large molecules from small subunits is known as what kind of reaction? O a reduction O b.condensation Oc decarboxylation d. hydrolysis O e. oxidation What is formed when an atom loses or gains an electron? O a. ion b....
4. Telomerases... a) are RNA-containing enzymes involved in replicating the ends of linear chromosomes b) cause aging in cells c) are structures located at the ends of eukaryotic chromosomes d) are needed by bacteria to complete synthesis of their chromosome ends e) are needed by bacteria to supercoil DNA 5. DNA methylation a) Modifies bases of tRNA molecules, allowing wobble b) Alters the activity of DNA polymerase by affecting access to the DNA c) Is a modification of histone tails...
QUESTION 5 Match these terms to the descriptions below. b. , is added onto mRNA during processing d , proteins that help initiate RNA synthesis a. spliceosome b. cap c. telomere d. transcription factors e. promoter a, removes introns from primary RNA transcript TATA-rich DNA sequence indicating the start site of a gene c repeating sequences found at the ends of linear DNA
12. The saccharide binding pockets in lysozyme were labeled A through F. Enzymes such as lysozyme are very specific; lysozyme will hydrolyze the polysaccharide at only one linkage: the linkage bound between A and B, or bound between B and C, etc. (see figure below). From the crystal structure, it was found a) NAG-NAG-NAG binds at sites A-C in the crystal structure, and b) that sites A, C and E could not accommodate NAM; NAM's extra lactyl group is too...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 14 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago