1) Which of the following molecules is most likely to be hydrophyllic?
A)C6H15 B) C6H12O6 C) both of these D) none of these
2)Which of the following molecules is most likely to be hydrophobic
A)NC3H6O2 B) C10H22 C) Na+Cl- D) none of these
3) Which of the following atoms are electronegative
A) Carbon and Hydrogen B) Nitrogen and Oxygen C) All of these are electropositive
4) What is the next largest level of organization after cells?
Tissues
A) Cells
B) Ecosystems
C) The Biosphere
5) Which is an example of a saturated hydrocarbon
A) C2H6
B) C2H4
6) Which is the trans isomer of an unsaturated fatty acid?
A) B) C)
1) Which of the following molecules is most likely to be hydrophyllic? A)C6H15 B) C6H12O6 C) both of...
please help me! :) 16. What is the name of the palmitoleate fatty acid above in omega, o notation? C) -9 A) -7 B) -8 D) -10 Page 3 of 10 First Name Dec 10, 2018 17.Which of the following is NOT a difference between the two fatty acids above, palmitoleate and vaccenate? A) they have a different total number of carbons B) they have a different omega, w notation C) one is cis and the other is trans double...
please please my last question, i will give 5 stars, thank u!!!! Warch of the following is the permeability of biological A. Cholesterol binds to the w ide varice of solutes. obiads to the outside worl B. Because choledere is which C. Because cholesterol is hihe diffusion through the membrane olesterol is a hydrocarbon that has twins in solutes from moving easily is w chehen th What is the name of the is the name of the currently do c...
Unsaturated fatty acids have lower melting points than saturated fatty acids because A. they have fewer hydrogen atoms B. They have more hydrogen atoms C. their molecules fit closely together D. the cis double bonds give them an irregular shape E. the trans double bonds give them an irregular shape
1. Blood sugar is A. dextrose. B. glucose. C. fructose. D. both A and B 2. Which product contains the most sugar per serving? A. beef steak B. fresh orange C. diet Mountain Dew D. wheat bran 3.Trans-fats are most abundant in A. animal fat. B. partially hydrogenated fat. C. completely hydrogenated fat. D. coconut oil. 4.High HDL levels are associated with A. a high risk of coronary artery disease. B. reduced risk of heart disease and stroke. C....
Which of the following processes will most likely occur when you transfer a bacterial culture from 37 degree C to 10 degree C? the bacteria will start synthesizing cholesterol the bacteria will remove cholesterol from their membranes the bacteria will reduce the number of unsaturated bonds in the fatty acid tails of their phospholipids the bacteria will increase the synthesis of phospholipids with very long fatty acid tails and insert these into their membranes the bacteria will increase the synthesis...
A8. Which of the following describes carbohydrates? (a) a base, a sugar, and a phosphate b) aldchydes and ketones with two or more hydroxyl groups. c) acids with two or more hydroxyl groups. d) amines with two or more hydroxyl groups. e) always contain a phosphate group. A9. Which of the following is NOT correct regarding reducing sugars? a) Sugars that react with oxidizing agents are called reducing sugars. b) The cyclic form of a monosaccharide reacts with oxidizing agents....
Which of the following molecules is unsaturated? A A) A B B) B C) C D DD Which of the following molecules is a ketone? A B OS H A) A B) B C) C i FO OH DD What is the common name of the following alkyl substituent? CH3 A) butyl B) sec-butyl H3C -C-CH3 C) isobutyl D) tert-butyl
Which of he fodlowing joints is most movable A. hinges B. ball and socket 13, Egin A. boh Bshe C.e D.sr D. saddle E plane ute 7. Rheumatoid arthritis is A. a metabolic disorder caused by increased urie acid in bilood. B. an inflammation of any joint C. the most common type of Da condition that may inode an autoimmune discase ritis E. a bacterial infection transmined by ticks 8. Solution A has a plH of 10 and solution B...
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...
14.Sucrose is composed of A. 1 molecule each of glucose and fructose. B. 1 molecule each of glucose and galactose. C. 2 glucose molecules. D. 2 galactose molecules. 15.Which hormone comes into play when the blood sugar dips too low? A. glucagon B. insulin C. gastrin D. estrogen 16.Which sweetener provides no calories to humans? A. sucrose B. sucralose (Splenda) C. xylitol D. fructose 17.______ and ______ acids are essential fatty acids. A. Acetic and butyric B. Oleic and linolenic...