what kind of enzyme breaks down nucleic acid?
what kind of enzyme breaks down nucleic acid?
Homework Answers
Answer) a group of enzymes which break nucleic acid are know as Nuclease . These Nuclease break the DNA or RNA. So they are know as DNAase and RNAase accordingly. They breakdown nucleotide into smaller pieces .
Question 11 What is the structure of an enzyme? Lipid Protein Nucleic acid Carbohydrate
Question 11 What is the structure of an enzyme? Lipid Protein Nucleic acid Carbohydrate
Look at the nutritional content of lactase milk. Lactose is an enzyme that breaks down the...
Look at the nutritional content of lactase milk. Lactose is an enzyme that breaks down the milk sugar lactose. For people who are lactose intolerant, lactase milk is more digestible. What can you conclude about the contents of lactose milk? Multiple Choice O Adding lactose increases the grams of sugars present compared to whole milk O C Although the lactase breaks down the disaccharide lactose, monosaccharides are still present O Adding lactase removes most of the sugar from the milk....
Do animals have an enzyme that breaks down hydrogen peroxide? How could you test for the...
Do animals have an enzyme that breaks down hydrogen peroxide? How could you test for the presence of such an enzyme?
RECOMBINANT DNA REVIEW 1. What is a nucleic acid probe and what is it used for?...
RECOMBINANT DNA REVIEW 1. What is a nucleic acid probe and what is it used for? 2. How does the DNA ligase enzyme work specificially?
Enzymes are described as having specific substrates. For example, lactase enzyme breaks down the substrate lactose,...
Enzymes are described as having specific substrates. For example, lactase enzyme breaks down the substrate lactose, a disaccharide, into glucose and galactose. Is lactase also able to break down starch, a polysaccharide made up of glucose?
True/false, if false explain why Callase enzyme, secreted by microspores, breaks down callose, which is a...
True/false, if false explain why Callase enzyme, secreted by microspores, breaks down callose, which is a polysaccharide that keeps microspores in tetrads.
When old aspirin breaks down salicylic acid is formed. What functional group does salicylic acid have...
When old aspirin breaks down salicylic acid is formed. What functional group does salicylic acid have that aspirin does not? -OH Opera Olaondo acid catalyst + some stuff -©—OH 0-C-CH3 + CH3—C—OH acetic acid OH aspirin Salicylic acid
10. Catalase is an enzyme that breaks down hydrogen peroxide into water and oxygen. A solution...
10. Catalase is an enzyme that breaks down hydrogen peroxide into water and oxygen. A solution containing catalase would show a positive result when: * O The solution is tested using the grease spot test O Biuret's reagent is added to the solution O Ninhydrin is added to the solution O Lugol's lodine is added to the solution O Benedict's reagent is added to the solution O This is a required question
The following is a short peptide that is part of the enzyme that breaks apart the...
The following is a short peptide that is part of the enzyme that breaks apart the molecule: Ile-Met-Val-Met-Ala-Ala. Will breaking down the molecule release or require energy?
3. (2 points) Urease is an enzyme produced by some bacteria that breaks down urea into...
3. (2 points) Urease is an enzyme produced by some bacteria that breaks down urea into ammonia. Humans produce urea in order to rid the body of waste nitrogen through urine. Ammonia is toxic to humans and can disrupt many of our cellular structures. Some pathogenic bacteria produce urease to break down urea into ammonia in our bodies and promote their infection. Look up urease on Wikipedia and name 3 diseases caused by bacterial infections where urease is important for...
Question 11 What is the structure of an enzyme? Lipid Protein Nucleic acid Carbohydrate
Look at the nutritional content of lactase milk. Lactose is an enzyme that breaks down the milk sugar lactose. For people who are lactose intolerant, lactase milk is more digestible. What can you conclude about the contents of lactose milk? Multiple Choice O Adding lactose increases the grams of sugars present compared to whole milk O C Although the lactase breaks down the disaccharide lactose, monosaccharides are still present O Adding lactase removes most of the sugar from the milk....
Enzymes are described as having specific substrates. For example, lactase enzyme breaks down the substrate lactose, a disaccharide, into glucose and galactose. Is lactase also able to break down starch, a polysaccharide made up of glucose?
When old aspirin breaks down salicylic acid is formed. What functional group does salicylic acid have that aspirin does not? -OH Opera Olaondo acid catalyst + some stuff -©—OH 0-C-CH3 + CH3—C—OH acetic acid OH aspirin Salicylic acid
10. Catalase is an enzyme that breaks down hydrogen peroxide into water and oxygen. A solution containing catalase would show a positive result when: * O The solution is tested using the grease spot test O Biuret's reagent is added to the solution O Ninhydrin is added to the solution O Lugol's lodine is added to the solution O Benedict's reagent is added to the solution O This is a required question
3. (2 points) Urease is an enzyme produced by some bacteria that breaks down urea into ammonia. Humans produce urea in order to rid the body of waste nitrogen through urine. Ammonia is toxic to humans and can disrupt many of our cellular structures. Some pathogenic bacteria produce urease to break down urea into ammonia in our bodies and promote their infection. Look up urease on Wikipedia and name 3 diseases caused by bacterial infections where urease is important for...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago