1) Provide the proper IUPAC name for the alkene shown below. CH2=CHCH2CH2CH2CH3 2) Provide the proper...

Question

Question

1) Provide the proper IUPAC name for the alkene shown below. CH2=CHCH2CH2CH2CH3 2) Provide the proper IUPAC name for the alke

science chemistry

Add a comment Improve this question Transcribed image text

Answer 1

Answer #1

1) The IUPAC name of the alkene is: Hex-1-ene

2) The IUPAC name of the structure is Cyclopent-1-ene

3) The structure should be:

CH2CHCH2(C2H5)CHCH2CH2CH3

4) The IUPAC namw of the structure is: 2,4-Dimethyl-hex-3-ene

Add a comment

Answer 2

Similar Homework Help Questions

1) Provide the proper IUPAC name for the alkene shown below. CH2=CHCH2CH2CH2CH3 2) Provide the proper...

1) Provide the proper IUPAC name for the alkene shown below. CH2=CHCH2CH2CH2CH3 2) Provide the proper IUPAC name for the alkene shown below. 3) Draw an acceptable structure for 4-ethylhept-1-ene. 4) Provide an acceptable name for (CH3)2CHCH-C(CH3)CH2CH3. 5) Provide an acceptable name for (CH3CH2)2CHCH2CH-CH2. 6) Name the compound shown below. 7) Provide the proper IUPAC name for the alkene shown below. 8) Provide the proper IUPAC name for the alkene shown below. 9) Draw an acceptable structure for 4-phenylbut-l-ene. 10)...
7) Provide the proper IUPAC name for the alkene shown below. 8) Provide the proper IUPAC...

7) Provide the proper IUPAC name for the alkene shown below. 8) Provide the proper IUPAC name for the alkene shown below. CH, CH,CH, 9) Draw an acceptable structure for 4-phenylbut-1-ene.
17) Provide the proper IUPAC name for the alkene shown below 3-boro, A mutin agionavane 18)...

17) Provide the proper IUPAC name for the alkene shown below 3-boro, A mutin agionavane 18) Provide the proper IUPAC name for the alkene shown below CH" 19) Draw an acceptable structure for 4-phenylbut-1-ene. 20) Draw an acceptable structure for 1,2-dimethylcyclohexene. 21) Draw and name all alkenes which have the molecular formula C4Hs. 22) Name the alkene shown. Be sure to include the appropriate E or Z label necessary CH,CH 22) 23) 23) Provide a correct IUPAC name for the...

4) Provide the structure of 1,3,5-heptatriene. 5) Provide the proper IUPAC name for the alkene shown...

4) Provide the structure of 1,3,5-heptatriene. 5) Provide the proper IUPAC name for the alkene shown be CH3 CH2 CH2 CH3 С=С CH3 CH2 CH3 3) Provide a correct IUPAC name for the structure below. 3- brome-1-metlylcyclopentan 19- H₃C 4) Provide the structure of 1,3,5-heptatriene.
15) Provide the proper IUPAC name for the alkene shown below. CH3 CH2 CH, CH CH,...

15) Provide the proper IUPAC name for the alkene shown below. CH3 CH2 CH, CH CH, CH2 CH3 16) Provide the proper IUPAC name for the alkene shown below. CICH, CH CH
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a...

Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....

Question 12 What is the correct IUPAC name for the following alkene? CH3 CHỊCH,CHC=CH, CH2CH3 a....

Question 12 What is the correct IUPAC name for the following alkene? CH3 CHỊCH,CHC=CH, CH2CH3 a. 2-ethyl-3-methylhex-2-ene b. octene c. 3-isobutyl)but-3-ene d. 3-methyl-4-ethylpent-4-ene e. 4-ethyl-3-methylpent-4-ene f. 2-ethyl-3-methylpent-1-ene Gg. 2-(sec-butyl)but-1-ene A Moving to another question will save this response.
1) Identify the correct name for the following structure н,с осна A) 3-methoxy-5-methyleyclohepta-1,5-diene B) 6-me...

1) Identify the correct name for the following structure н,с осна A) 3-methoxy-5-methyleyclohepta-1,5-diene B) 6-methoxy-1-methylcyclohepta-1,4-diene C) 7-methoxy-5-methylcyclohepta-1,4-diene D) 4-methoxy-2-methyleyclohepta-1,5-diene 2) Name the alkene shown. Be sure to include the appropriate E or Z label necessary. CH-CH-C H CI 3) Provide a correct IUPAC name for the structure below. Н,с 4) Provide the structure of 1,3,5-heptatriene. 5) Provide the proper IUPAC name for the alkene shown below. CH3 CH, CH CHy CH3 CH2 CH3
what is the ideal speed to take a 85 m radius curve banked at 30.0 angle 4) Provide acceptable IUPAC name for t...

what is the ideal speed to take a 85 m radius curve banked at 30.0 angle 4) Provide acceptable IUPAC name for the structure below 5) Provide a complete name that includes the descriptor for the alkene shown below H2SO4 You Husoo HCI w 1) BH 2) H2O, OH NBS DMSO H2O 6) Draw the two products that result from ozonolysis of 2-methyloct-2-ene 7) Which reagent adds to an alkene exclusively in an ANTI fashion? A)HPd-C (B) Brz (C BH3,...

What is the systematic IUPAC name for the following Organic compound? OH O a. 2-Ethyl-7-oxodecanoic acid...

What is the systematic IUPAC name for the following Organic compound? OH O a. 2-Ethyl-7-oxodecanoic acid O b. 2-Ethyl-1,7-dioxodecan-1-ol c. 3-Carboxy-8-oxoundecane d. 9-Ethyl-4-oxodecanoic acid e. 1-Hydroxydecan-1,7-dione f. 9-Ethyl-4-oxodecanal What is the correct IUPAC name for the following alkene? CH3 CH3CH2CHC=CH2 CH2CH3 a. 2-(sec-butyl)but-1-ene b. 3-isobutylbut-3-ene c. 4-ethyl-3-methylpent-4-ene d. 2-ethyl-3-methylpent-l-ene e. 3-methyl-4-ethylpent-4-ene f. 2-ethyl-3-methylhex-2-ene g. octene

1) Provide the proper IUPAC name for the alkene shown below. CH2=CHCH2CH2CH2CH3 2) Provide the proper...

Homework Answers