Homework Answers
there are several mechanisms that ensure that only correct amino acid should be attached to tRNA but if an incorrect amino acid is added to tRNA there is no way to prevent its incorporation in the polypeptide. Since the anticodon is correct it will base pair with the codon in mRNA and you will have a peptide with wrong amino acid incorporated.
Hence option D is right
Add Answer to:
12. If an aminoacyl-tRNA synthetase attaches the wrong amino acid to a tRNA, what will happen?...
Complete the following reactions: 1. Amino acid-ERNA coupling on the aminoacyl-tRNA synthetase Step 1: Adenosine 0...
Complete the following reactions: 1. Amino acid-ERNA coupling on the aminoacyl-tRNA synthetase Step 1: Adenosine 0 0 0-P-O-P-O-P-0 0 0 0 B RNA synthetase side-product Step 2: "organic product "organic product tRNA Adenosine 6-- 0 0 TANA synthetase HOH OH side-product 2. Peptide coupling on the ribosome: OH. CO н со ribosome HEC tRNA RNA A-Site
What is an aminoacyl tRNA synthetase? How does it attach amino acids? How is it specific?
What is an aminoacyl tRNA synthetase? How does it attach amino acids? How is it specific?
How is the correct amino acid bound to its appropriate tRNA molecule? ANSWER A IS WRONG...
How is the correct amino acid bound to its appropriate tRNA molecule? ANSWER A IS WRONG A. they are bound by the enzyme amino acyl tRNA synthetase in the nucleus B. they are bound by the enzyme amino acyl tRNA synthetase in the cytoplasm C. they are linked during modification in the rough ER D. they are connected by RNA polymerase in the nucleus
3. What are the “translator” molecules that recognize a codon in the mRNA and deliver the correct...
3. What are the “translator” molecules that recognize a codon in the mRNA and deliver the correct amino acid? 6. If each amino acid was encoded by a single codon, what is the minimum number of amino-acyl tRNA synthetases required for translation? 7. Looking at the codon table, if there was a unique aminoacyl-tRNA synthetase required for each anticodon, what is the minimum required? 9. If an aminoacyl-tRNA synthetase recognized any nucleotide (purine or pyrimidine) in the 5’end of the anticodon,...
Which one of the following is true? a. tRNA synthetase loads the correct amino acid on...
Which one of the following is true? a. tRNA synthetase loads the correct amino acid on tRNA b. Ribosomes read RNA in the 5'+3' direction during protein synthesis c. STOP codons are degenerate d. DNA transcription produces mRNA in bacteria e. a, b, d f. a, d g. None of the above h. All of the above Which of the following destabilizes the tertiary structure of proteins? a. Hydrophobic (nonpolar) interactions b. Dipole moments between parallel alpha helices c. Van...
23. What ensures that the correct amino acid is added during translation? A. the methyl-guanosine cap...
23. What ensures that the correct amino acid is added during translation? A. the methyl-guanosine cap of a properly modified mRNA B. transcription factors C. the anticodon of a properly formed aminoacyl tRNA D. the sequence of the coding strand E. all of the above 24. If the DNA code for a particular amino acid is 5'AGT3', then the anticodon on the tRNA would be A. 5'TCA3 B. 5'UCA3 C. 5'AGU3 D. 5'ACU3 E. 5'UCA3 25. What enzyme catalyzes the...
30) The organelle that performs the process of translation has room for thre mRNA/ rRNA/ tRNA) molecules. Except for the molecule carrying the very first amino acid, all enter this organelle at t...
30) The organelle that performs the process of translation has room for thre mRNA/ rRNA/ tRNA) molecules. Except for the molecule carrying the very first amino acid, all enter this organelle at the site. The movement of the ribosome with respect to the mRNA is (translation/ translocation), and it occurs each time a known as new amino acid is added to the polypeptide chain, in other words, during the cycle of the ribosome. This movement is powered by the ATP/...
23a. TRANSLATION Preparation Due 3-11 Read textbook Sections 17.3-17.5 Please submit your worksheer online (.docx er...
23a. TRANSLATION Preparation Due 3-11 Read textbook Sections 17.3-17.5 Please submit your worksheer online (.docx er yd) or type up the answers to submit Learning Goals a. Compare translation in prokaryotes and eukaryotes. b. Recount the events of translation initiation, elongation, and termination. c. Link ribosomal activity to the secretory pathway. d. Diagram the relationship between a gene, an immature mRNA, a mature mRNA, and a protein. 1. Approximately how many codons are minimally required to encode a polypeptide chain...
During the ‘elongation’ stage of translation, after the arrival of each new tRNA: A. the amino...
During the ‘elongation’ stage of translation, after the arrival of each new tRNA: A. the amino acid is ‘passed’ from the tRNA in the A site to the tRNA in the P site. B. newly arriving tRNAs must first bind to the E-site. C. the peptide is ‘passed’ from the tRNA in the P site to the tRNA in the A site. D. the new tRNA must first bind to the P-site of the ribosome Hi, i need help with...
18. The job of the tRNA is to A. Bring the correct amino acid to the...
18. The job of the tRNA is to A. Bring the correct amino acid to the ribosome B. Ship the finished proteins to their proper locations in the cell C. Terminate the mRNA D. Transcribe the gene E. Transform the DNA 19.How many codons code for amino acids? A. 4 B. 16 C. 20 D. 61 E. 64 20. The process of translation A. Makes DNA B.Makes mRNA C. Makes new cells D. Makes protein E. Makes tRNA 21. During...
Complete the following reactions: 1. Amino acid-ERNA coupling on the aminoacyl-tRNA synthetase Step 1: Adenosine 0 0 0-P-O-P-O-P-0 0 0 0 B RNA synthetase side-product Step 2: "organic product "organic product tRNA Adenosine 6-- 0 0 TANA synthetase HOH OH side-product 2. Peptide coupling on the ribosome: OH. CO н со ribosome HEC tRNA RNA A-Site
Which one of the following is true? a. tRNA synthetase loads the correct amino acid on tRNA b. Ribosomes read RNA in the 5'+3' direction during protein synthesis c. STOP codons are degenerate d. DNA transcription produces mRNA in bacteria e. a, b, d f. a, d g. None of the above h. All of the above Which of the following destabilizes the tertiary structure of proteins? a. Hydrophobic (nonpolar) interactions b. Dipole moments between parallel alpha helices c. Van...
23. What ensures that the correct amino acid is added during translation? A. the methyl-guanosine cap of a properly modified mRNA B. transcription factors C. the anticodon of a properly formed aminoacyl tRNA D. the sequence of the coding strand E. all of the above 24. If the DNA code for a particular amino acid is 5'AGT3', then the anticodon on the tRNA would be A. 5'TCA3 B. 5'UCA3 C. 5'AGU3 D. 5'ACU3 E. 5'UCA3 25. What enzyme catalyzes the...
30) The organelle that performs the process of translation has room for thre mRNA/ rRNA/ tRNA) molecules. Except for the molecule carrying the very first amino acid, all enter this organelle at the site. The movement of the ribosome with respect to the mRNA is (translation/ translocation), and it occurs each time a known as new amino acid is added to the polypeptide chain, in other words, during the cycle of the ribosome. This movement is powered by the ATP/...
23a. TRANSLATION Preparation Due 3-11 Read textbook Sections 17.3-17.5 Please submit your worksheer online (.docx er yd) or type up the answers to submit Learning Goals a. Compare translation in prokaryotes and eukaryotes. b. Recount the events of translation initiation, elongation, and termination. c. Link ribosomal activity to the secretory pathway. d. Diagram the relationship between a gene, an immature mRNA, a mature mRNA, and a protein. 1. Approximately how many codons are minimally required to encode a polypeptide chain...
18. The job of the tRNA is to A. Bring the correct amino acid to the ribosome B. Ship the finished proteins to their proper locations in the cell C. Terminate the mRNA D. Transcribe the gene E. Transform the DNA 19.How many codons code for amino acids? A. 4 B. 16 C. 20 D. 61 E. 64 20. The process of translation A. Makes DNA B.Makes mRNA C. Makes new cells D. Makes protein E. Makes tRNA 21. During...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 39 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago