Homework Answers
Ans-4) The two gene products that are RNA molecules are mRNA and tRNA known as messenger RNA and Transfer RNA respectively.
mRNA acts as an intermediate between the genetic information in DNA and the amino acid sequence of proteins. Whereas, tRNA reads the genetic information of nucleic acids and translates it into proteins.
Add Answer to:
4) Translation does not always follow transcription. When the end product of the gene is a...
where does transcription begin 3. List the major types of RNA and include what they code...
where does transcription begin
3. List the major types of RNA and include what they code for, their function in the cell and which type is translated. 4. If a bacterial protein has 2,500 amino acids long, how many nucleotide pairs long is the ger sequence that codes for it? 5. Where does transcription begin? 6. What is the template and nontemplate strands of DNA? 7. Why is only one strand transcribed, and is the same strand of DNA always...
This problem will require you to think about gene expression (transcription and translation) as well as...
This problem will require you to think about gene expression (transcription and translation) as well as energy metabolism. 1. Consider a yeast cell which wants to express a 900 bp gene. Assuming this gene has no introns, ignoring any 5’ or 3’ untranslated regions, and assuming a 100 bp poly-A tail, how many nucleotides are required to transcribe this gene? For simplicity’s sake, let’s assume all the nucleotides are ATP. 2. Based on what you know about translation, how many...
Each statement describes a type of gene regulation. Determine if it describes regulation at the transcription,...
Each statement describes a type of gene regulation. Determine if it describes regulation at the transcription, translation or post-translation level. 1. Genetic regulatory proteins bind to the DNA. Transcription / Posttranslation / Translation 2. A transcription terminator forms in the RNA. Transcription / Translation / Posttranslation 3. Repressor proteins bind to an mRNA and prevent ribosome binding.Translation / Posttranslation / Transcription 4. Riboswitches produce an RNA conformation that prevents ribosome binding. Posttranslation/ Translation/ Transcription 5. Antisense RNA binds to the...
Transcription is the process of rewriting DNA. DNA molecules are made from 4 different nucleotides which...
Transcription is the process of rewriting DNA. DNA molecules are made from 4 different nucleotides which acts as building blocks. These building blocks are adenine, thymine, guanine and cytosine. When put together in different chemical combinations they become directions for the functions of the cell molecules which are primarily proteins. When a certain protein is needed, the RNA polymerase enzyme will find the gene for that particular protein and makes an RNA copy of it. DNA and RNA have similar...
4. A protein that works with RNA polymerase in prokaryotes to initiate transcription (two words, no spaces)....
4. A protein that works with RNA polymerase in prokaryotes to initiate transcription (two words, no spaces). 5. Prokaryotic transcription and translation are events. 7. The DNA used as a template molecule during transcription is an molecule. 8. The leading strand of DNA is synthesized 9. The sequence of DNA found 35 base pairs upstream from the start of a gene in prokaryotes
25. What is a riboswitch? A. a small molecule that regulates the translation of specific mRNAs...
25. What is a riboswitch? A. a small molecule that regulates the translation of specific mRNAs B. a gene regulatory protein that turns on the expression of ribosomal proteins C. an mRNA that can regulate its own transcription and translation D. a ribosome that participates in attenuation E. when the antisense RNA binds to the transcript 26. In the Ames Test, the appearance of his+ revertants in the presence of a non-mutagenic control compound indicates that _______. A. liver extract...
4. When & where does replication occur? 5. What is the point of transcription? Where does it occur? 6. What are...
4. When & where does replication occur? 5. What is the point of transcription? Where does it occur? 6. What are three nucleotides together called on mRNA? (ie: ACA) 7. The mRNA codons can be used in a chart to find: 8. What molecule contains an anti-codon? During what process is it used? 10. Translation takes place in a 11. and _make up ribosomes. 12. What is the point of translation? 13. Transcription and translation together is the process of
Two genes (B and C) are transcription factors that affect the expression of gene A. The...
Two genes (B and C) are transcription factors that affect the expression of gene A. The protein product of gene B allows gene A to be transcribed while the protein product of gene C doubles the rate of transcription of gene A. How does the expression of gene A differ between two individuals with the following genotypes? Assume lower case alleles produce non-functional proteins and each gene shows complete dominance. Individual 1: AA : BB : Cc Individual 2: AA...
What is the relationship between protein translation and gene expression? Would you expect to always see...
What is the relationship between protein translation and gene expression? Would you expect to always see correlation between these two? Discuss a circumstance within the context of cancer where mRNA and protein expression may not correlate. Why is it important to look at both protein and RNA levels of a series of genes/proteins in a molecular pathway? Discuss this in the context of cancer associated pathways. Give a specific example of a pathway that is independent of gene expression in...
A cell that is heterozygous for a nonsense mutation in a tumor suppressor gene would most...
A cell that is heterozygous for a nonsense mutation in a tumor suppressor gene would most likely: A) Group of answer choices B) grow but not divide C) have a normal cell cycle D) arrest and induce apoptosis E) have a slightly increased cell cycle and increased cell growth F) grow and divide uncontrollably Which of the following correctly describes an event that occurs during transcription: Group of answer choices A) A DNA molecule is chemically modified to become a...
where does transcription begin
3. List the major types of RNA and include what they code for, their function in the cell and which type is translated. 4. If a bacterial protein has 2,500 amino acids long, how many nucleotide pairs long is the ger sequence that codes for it? 5. Where does transcription begin? 6. What is the template and nontemplate strands of DNA? 7. Why is only one strand transcribed, and is the same strand of DNA always...
4. When & where does replication occur? 5. What is the point of transcription? Where does it occur? 6. What are three nucleotides together called on mRNA? (ie: ACA) 7. The mRNA codons can be used in a chart to find: 8. What molecule contains an anti-codon? During what process is it used? 10. Translation takes place in a 11. and _make up ribosomes. 12. What is the point of translation? 13. Transcription and translation together is the process of
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 40 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago